C22H23F3N4O2 — CID 91925970
1-(pyridin-3-ylmethyl)-3-[4-[4-(trifluoromethyl)benzoyl]piperazin-1-yl]pyrrolidin-2-one (PubChem CID 91925970) has the molecular formula C22H23F3N4O2 and a molecular weight of 432.45 g/mol. Its IUPAC name is 1-(pyridin-3-ylmethyl)-3-[4-[4-(trifluoromethyl)benzoyl]piperazin-1-yl]pyrrolidin-2-one.
| Compound Name | 1-(pyridin-3-ylmethyl)-3-[4-[4-(trifluoromethyl)benzoyl]piperazin-1-yl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 91925970 |
| Molecular Formula | C22H23F3N4O2 |
| Molecular Weight | 432.45 g/mol |
| Exact Mass | 432.18 |
| IUPAC Name | 1-(pyridin-3-ylmethyl)-3-[4-[4-(trifluoromethyl)benzoyl]piperazin-1-yl]pyrrolidin-2-one |
| SMILES | O=C(c1ccc(C(F)(F)F)cc1)N1CCN(C2CCN(Cc3cccnc3)C2=O)CC1 |
| InChI | InChI=1S/C22H23F3N4O2/c23-22(24,25)18-5-3-17(4-6-18)20(30)28-12-10-27(11-13-28)19-7-9-29(21(19)31)15-16-2-1-8-26-14-16/h1-6,8,14,19H,7,9-13,15H2 |
| InChIKey | VGAUUEHEPDYCEI-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 56.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.45 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |