About 3-[4-(3,5-difluorobenzoyl)piperazin-1-yl]-1-(pyridin-3-ylmethyl)pyrrolidin-2-one
3-[4-(3,5-difluorobenzoyl)piperazin-1-yl]-1-(pyridin-3-ylmethyl)pyrrolidin-2-one (PubChem CID 91925972) has the molecular formula C21H22F2N4O2
and a molecular weight of 400.43 g/mol. Its IUPAC name is 3-[4-(3,5-difluorobenzoyl)piperazin-1-yl]-1-(pyridin-3-ylmethyl)pyrrolidin-2-one.
Molecular Properties
| Compound Name | 3-[4-(3,5-difluorobenzoyl)piperazin-1-yl]-1-(pyridin-3-ylmethyl)pyrrolidin-2-one |
| PubChem CID | 91925972 |
| Molecular Formula | C21H22F2N4O2 |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | 3-[4-(3,5-difluorobenzoyl)piperazin-1-yl]-1-(pyridin-3-ylmethyl)pyrrolidin-2-one |
| SMILES | O=C(c1cc(F)cc(F)c1)N1CCN(C2CCN(Cc3cccnc3)C2=O)CC1 |
| InChI | InChI=1S/C21H22F2N4O2/c22-17-10-16(11-18(23)12-17)20(28)26-8-6-25(7-9-26)19-3-5-27(21(19)29)14-15-2-1-4-24-13-15/h1-2,4,10-13,19H,3,5-9,14H2 |
| InChIKey | GCIGGPQWCKIITL-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 56.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[4-(3,5-difluorobenzoyl)piperazin-1-yl]-1-(pyridin-3-ylmethyl)pyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-(3,5-difluorobenzoyl)piperazin-1-yl]-1-(pyridin-3-ylmethyl)pyrrolidin-2-one?
The IUPAC name of 3-[4-(3,5-difluorobenzoyl)piperazin-1-yl]-1-(pyridin-3-ylmethyl)pyrrolidin-2-one (CID 91925972) is 3-[4-(3,5-difluorobenzoyl)piperazin-1-yl]-1-(pyridin-3-ylmethyl)pyrrolidin-2-one.
What is the SMILES notation for 3-[4-(3,5-difluorobenzoyl)piperazin-1-yl]-1-(pyridin-3-ylmethyl)pyrrolidin-2-one?
The canonical SMILES for 3-[4-(3,5-difluorobenzoyl)piperazin-1-yl]-1-(pyridin-3-ylmethyl)pyrrolidin-2-one is O=C(c1cc(F)cc(F)c1)N1CCN(C2CCN(Cc3cccnc3)C2=O)CC1.
What is the InChIKey of 3-[4-(3,5-difluorobenzoyl)piperazin-1-yl]-1-(pyridin-3-ylmethyl)pyrrolidin-2-one?
The InChIKey is GCIGGPQWCKIITL-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22F2N4O2/c22-17-10-16(11-18(23)12-17)20(28)26-8-6-25(7-9-26)19-3-5-27(21(19)29)14-15-2-1-4-24-13-15/h1-2,4,10-13,19H,3,5-9,14H2.
What are the key properties of 3-[4-(3,5-difluorobenzoyl)piperazin-1-yl]-1-(pyridin-3-ylmethyl)pyrrolidin-2-one?
3-[4-(3,5-difluorobenzoyl)piperazin-1-yl]-1-(pyridin-3-ylmethyl)pyrrolidin-2-one has a molecular weight of 400.43 g/mol, XLogP of 1.92, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-(3,5-difluorobenzoyl)piperazin-1-yl]-1-(pyridin-3-ylmethyl)pyrrolidin-2-one is sourced from PubChem (CID 91925972), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).