C22H25FN4O2 — CID 91925976
3-[4-[2-(2-fluorophenyl)acetyl]piperazin-1-yl]-1-(pyridin-3-ylmethyl)pyrrolidin-2-one (PubChem CID 91925976) has the molecular formula C22H25FN4O2 and a molecular weight of 396.47 g/mol. Its IUPAC name is 3-[4-[2-(2-fluorophenyl)acetyl]piperazin-1-yl]-1-(pyridin-3-ylmethyl)pyrrolidin-2-one.
| Compound Name | 3-[4-[2-(2-fluorophenyl)acetyl]piperazin-1-yl]-1-(pyridin-3-ylmethyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 91925976 |
| Molecular Formula | C22H25FN4O2 |
| Molecular Weight | 396.47 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | 3-[4-[2-(2-fluorophenyl)acetyl]piperazin-1-yl]-1-(pyridin-3-ylmethyl)pyrrolidin-2-one |
| SMILES | O=C(Cc1ccccc1F)N1CCN(C2CCN(Cc3cccnc3)C2=O)CC1 |
| InChI | InChI=1S/C22H25FN4O2/c23-19-6-2-1-5-18(19)14-21(28)26-12-10-25(11-13-26)20-7-9-27(22(20)29)16-17-4-3-8-24-15-17/h1-6,8,15,20H,7,9-14,16H2 |
| InChIKey | WIBXBWQXYHTDOC-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 56.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.47 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |