About 2-[2-methyl-5,7-bis(trifluoromethyl)imidazo[4,5-b]pyridin-3-yl]ethanol
2-[2-methyl-5,7-bis(trifluoromethyl)imidazo[4,5-b]pyridin-3-yl]ethanol (PubChem CID 91926273) has the molecular formula C11H9F6N3O
and a molecular weight of 313.20 g/mol. Its IUPAC name is 2-[2-methyl-5,7-bis(trifluoromethyl)imidazo[4,5-b]pyridin-3-yl]ethanol.
Molecular Properties
| Compound Name | 2-[2-methyl-5,7-bis(trifluoromethyl)imidazo[4,5-b]pyridin-3-yl]ethanol |
| PubChem CID | 91926273 |
| Molecular Formula | C11H9F6N3O |
| Molecular Weight | 313.20 g/mol |
| Exact Mass | 313.06 |
| IUPAC Name | 2-[2-methyl-5,7-bis(trifluoromethyl)imidazo[4,5-b]pyridin-3-yl]ethanol |
| SMILES | Cc1nc2c(C(F)(F)F)cc(C(F)(F)F)nc2n1CCO |
| InChI | InChI=1S/C11H9F6N3O/c1-5-18-8-6(10(12,13)14)4-7(11(15,16)17)19-9(8)20(5)2-3-21/h4,21H,2-3H2,1H3 |
| InChIKey | QEXHDBCAGDPKPC-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.20 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[2-methyl-5,7-bis(trifluoromethyl)imidazo[4,5-b]pyridin-3-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-methyl-5,7-bis(trifluoromethyl)imidazo[4,5-b]pyridin-3-yl]ethanol?
The IUPAC name of 2-[2-methyl-5,7-bis(trifluoromethyl)imidazo[4,5-b]pyridin-3-yl]ethanol (CID 91926273) is 2-[2-methyl-5,7-bis(trifluoromethyl)imidazo[4,5-b]pyridin-3-yl]ethanol.
What is the SMILES notation for 2-[2-methyl-5,7-bis(trifluoromethyl)imidazo[4,5-b]pyridin-3-yl]ethanol?
The canonical SMILES for 2-[2-methyl-5,7-bis(trifluoromethyl)imidazo[4,5-b]pyridin-3-yl]ethanol is Cc1nc2c(C(F)(F)F)cc(C(F)(F)F)nc2n1CCO.
What is the InChIKey of 2-[2-methyl-5,7-bis(trifluoromethyl)imidazo[4,5-b]pyridin-3-yl]ethanol?
The InChIKey is QEXHDBCAGDPKPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9F6N3O/c1-5-18-8-6(10(12,13)14)4-7(11(15,16)17)19-9(8)20(5)2-3-21/h4,21H,2-3H2,1H3.
What are the key properties of 2-[2-methyl-5,7-bis(trifluoromethyl)imidazo[4,5-b]pyridin-3-yl]ethanol?
2-[2-methyl-5,7-bis(trifluoromethyl)imidazo[4,5-b]pyridin-3-yl]ethanol has a molecular weight of 313.20 g/mol, XLogP of 2.77, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-methyl-5,7-bis(trifluoromethyl)imidazo[4,5-b]pyridin-3-yl]ethanol is sourced from PubChem (CID 91926273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).