About 2-N,2-N-diethyl-1,3-thiazole-2,4-diamine;hydrochloride
2-N,2-N-diethyl-1,3-thiazole-2,4-diamine;hydrochloride (PubChem CID 91927292) has the molecular formula C7H14ClN3S
and a molecular weight of 207.73 g/mol. Its IUPAC name is 2-N,2-N-diethyl-1,3-thiazole-2,4-diamine;hydrochloride.
Analyze 2-N,2-N-diethyl-1,3-thiazole-2,4-diamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N,2-N-diethyl-1,3-thiazole-2,4-diamine;hydrochloride?
The IUPAC name of 2-N,2-N-diethyl-1,3-thiazole-2,4-diamine;hydrochloride (CID 91927292) is 2-N,2-N-diethyl-1,3-thiazole-2,4-diamine;hydrochloride.
What is the SMILES notation for 2-N,2-N-diethyl-1,3-thiazole-2,4-diamine;hydrochloride?
The canonical SMILES for 2-N,2-N-diethyl-1,3-thiazole-2,4-diamine;hydrochloride is CCN(CC)c1nc(N)cs1.Cl.
What is the InChIKey of 2-N,2-N-diethyl-1,3-thiazole-2,4-diamine;hydrochloride?
The InChIKey is FWGQFRSIZUAIKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13N3S.ClH/c1-3-10(4-2)7-9-6(8)5-11-7;/h5H,3-4,8H2,1-2H3;1H.
What are the key properties of 2-N,2-N-diethyl-1,3-thiazole-2,4-diamine;hydrochloride?
2-N,2-N-diethyl-1,3-thiazole-2,4-diamine;hydrochloride has a molecular weight of 207.73 g/mol, XLogP of 1.99, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N,2-N-diethyl-1,3-thiazole-2,4-diamine;hydrochloride is sourced from PubChem (CID 91927292), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).