C13H12F3N5S — CID 91927366
[[4-(4-methylphenyl)-6-(trifluoromethyl)pyrimidin-2-yl]amino]thiourea (PubChem CID 91927366) has the molecular formula C13H12F3N5S and a molecular weight of 327.34 g/mol. Its IUPAC name is [[4-(4-methylphenyl)-6-(trifluoromethyl)pyrimidin-2-yl]amino]thiourea.
| Compound Name | [[4-(4-methylphenyl)-6-(trifluoromethyl)pyrimidin-2-yl]amino]thiourea |
|---|---|
| PubChem CID | 91927366 |
| Molecular Formula | C13H12F3N5S |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.08 |
| IUPAC Name | [[4-(4-methylphenyl)-6-(trifluoromethyl)pyrimidin-2-yl]amino]thiourea |
| SMILES | Cc1ccc(-c2cc(C(F)(F)F)nc(NNC(N)=S)n2)cc1 |
| InChI | InChI=1S/C13H12F3N5S/c1-7-2-4-8(5-3-7)9-6-10(13(14,15)16)19-12(18-9)21-20-11(17)22/h2-6H,1H3,(H3,17,20,22)(H,18,19,21) |
| InChIKey | TUOHYDYTKBEEDB-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|