C11H13N2S- — CID 91928159
N-(cyclopenta-1,4-dien-1-ylmethyl)-1-(1,3-thiazol-4-yl)ethanamine (PubChem CID 91928159) has the molecular formula C11H13N2S- and a molecular weight of 205.31 g/mol. Its IUPAC name is N-(cyclopenta-1,4-dien-1-ylmethyl)-1-(1,3-thiazol-4-yl)ethanamine.
| Compound Name | N-(cyclopenta-1,4-dien-1-ylmethyl)-1-(1,3-thiazol-4-yl)ethanamine |
|---|---|
| PubChem CID | 91928159 |
| Molecular Formula | C11H13N2S- |
| Molecular Weight | 205.31 g/mol |
| Exact Mass | 205.08 |
| IUPAC Name | N-(cyclopenta-1,4-dien-1-ylmethyl)-1-(1,3-thiazol-4-yl)ethanamine |
| SMILES | CC(NCc1cc[cH-]c1)c1cscn1 |
| InChI | InChI=1S/C11H13N2S/c1-9(11-7-14-8-13-11)12-6-10-4-2-3-5-10/h2-5,7-9,12H,6H2,1H3/q-1 |
| InChIKey | XYYQVMJWOWVVRY-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.31 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|