C9H10N2O5S2 — CID 91928409
N-[(1,1,3-trioxo-1,2-benzothiazol-6-yl)methyl]methanesulfonamide (PubChem CID 91928409) has the molecular formula C9H10N2O5S2 and a molecular weight of 290.32 g/mol. Its IUPAC name is N-[(1,1,3-trioxo-1,2-benzothiazol-6-yl)methyl]methanesulfonamide.
| Compound Name | N-[(1,1,3-trioxo-1,2-benzothiazol-6-yl)methyl]methanesulfonamide |
|---|---|
| PubChem CID | 91928409 |
| Molecular Formula | C9H10N2O5S2 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.00 |
| IUPAC Name | N-[(1,1,3-trioxo-1,2-benzothiazol-6-yl)methyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NCc1ccc2c(c1)S(=O)(=O)NC2=O |
| InChI | InChI=1S/C9H10N2O5S2/c1-17(13,14)10-5-6-2-3-7-8(4-6)18(15,16)11-9(7)12/h2-4,10H,5H2,1H3,(H,11,12) |
| InChIKey | IQGXFBWBHSRBEP-UHFFFAOYSA-N |
| XLogP | -0.83 |
| TPSA | 109.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |