About 5-methylsulfonyl-2,3-dihydro-1H-isoindole-1-carboxylic acid
5-methylsulfonyl-2,3-dihydro-1H-isoindole-1-carboxylic acid (PubChem CID 91928411) has the molecular formula C10H11NO4S
and a molecular weight of 241.27 g/mol. Its IUPAC name is 5-methylsulfonyl-2,3-dihydro-1H-isoindole-1-carboxylic acid.
Molecular Properties
| Compound Name | 5-methylsulfonyl-2,3-dihydro-1H-isoindole-1-carboxylic acid |
| PubChem CID | 91928411 |
| Molecular Formula | C10H11NO4S |
| Molecular Weight | 241.27 g/mol |
| Exact Mass | 241.04 |
| IUPAC Name | 5-methylsulfonyl-2,3-dihydro-1H-isoindole-1-carboxylic acid |
| SMILES | CS(=O)(=O)c1ccc2c(c1)CNC2C(=O)O |
| InChI | InChI=1S/C10H11NO4S/c1-16(14,15)7-2-3-8-6(4-7)5-11-9(8)10(12)13/h2-4,9,11H,5H2,1H3,(H,12,13) |
| InChIKey | BAPXNVOUCFRNSO-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.27 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-methylsulfonyl-2,3-dihydro-1H-isoindole-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methylsulfonyl-2,3-dihydro-1H-isoindole-1-carboxylic acid?
The IUPAC name of 5-methylsulfonyl-2,3-dihydro-1H-isoindole-1-carboxylic acid (CID 91928411) is 5-methylsulfonyl-2,3-dihydro-1H-isoindole-1-carboxylic acid.
What is the SMILES notation for 5-methylsulfonyl-2,3-dihydro-1H-isoindole-1-carboxylic acid?
The canonical SMILES for 5-methylsulfonyl-2,3-dihydro-1H-isoindole-1-carboxylic acid is CS(=O)(=O)c1ccc2c(c1)CNC2C(=O)O.
What is the InChIKey of 5-methylsulfonyl-2,3-dihydro-1H-isoindole-1-carboxylic acid?
The InChIKey is BAPXNVOUCFRNSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO4S/c1-16(14,15)7-2-3-8-6(4-7)5-11-9(8)10(12)13/h2-4,9,11H,5H2,1H3,(H,12,13).
What are the key properties of 5-methylsulfonyl-2,3-dihydro-1H-isoindole-1-carboxylic acid?
5-methylsulfonyl-2,3-dihydro-1H-isoindole-1-carboxylic acid has a molecular weight of 241.27 g/mol, XLogP of 0.32, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methylsulfonyl-2,3-dihydro-1H-isoindole-1-carboxylic acid is sourced from PubChem (CID 91928411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).