C19H15N5OS — CID 91928608
2-methyl-N-[3-[5-(1,3-thiazol-5-yl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]phenyl]prop-2-enamide (PubChem CID 91928608) has the molecular formula C19H15N5OS and a molecular weight of 361.43 g/mol. Its IUPAC name is 2-methyl-N-[3-[5-(1,3-thiazol-5-yl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]phenyl]prop-2-enamide.
| Compound Name | 2-methyl-N-[3-[5-(1,3-thiazol-5-yl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 91928608 |
| Molecular Formula | C19H15N5OS |
| Molecular Weight | 361.43 g/mol |
| Exact Mass | 361.10 |
| IUPAC Name | 2-methyl-N-[3-[5-(1,3-thiazol-5-yl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]phenyl]prop-2-enamide |
| SMILES | C=C(C)C(=O)Nc1cccc(-c2ncnc3[nH]cc(-c4cncs4)c23)c1 |
| InChI | InChI=1S/C19H15N5OS/c1-11(2)19(25)24-13-5-3-4-12(6-13)17-16-14(15-8-20-10-26-15)7-21-18(16)23-9-22-17/h3-10H,1H2,2H3,(H,24,25)(H,21,22,23) |
| InChIKey | NHPRXSXXOAKKKT-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.43 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|