C21H31O5- — CID 91928764
(3R)-6-[2-(cyclohexylmethyl)-4,6-dimethylphenoxy]-3,5-dihydroxyhexanoate (PubChem CID 91928764) has the molecular formula C21H31O5- and a molecular weight of 363.47 g/mol. Its IUPAC name is (3R)-6-[2-(cyclohexylmethyl)-4,6-dimethylphenoxy]-3,5-dihydroxyhexanoate.
| Compound Name | (3R)-6-[2-(cyclohexylmethyl)-4,6-dimethylphenoxy]-3,5-dihydroxyhexanoate |
|---|---|
| PubChem CID | 91928764 |
| Molecular Formula | C21H31O5- |
| Molecular Weight | 363.47 g/mol |
| Exact Mass | 363.22 |
| IUPAC Name | (3R)-6-[2-(cyclohexylmethyl)-4,6-dimethylphenoxy]-3,5-dihydroxyhexanoate |
| SMILES | Cc1cc(C)c(OCC(O)C[C@@H](O)CC(=O)[O-])c(CC2CCCCC2)c1 |
| InChI | InChI=1S/C21H32O5/c1-14-8-15(2)21(17(9-14)10-16-6-4-3-5-7-16)26-13-19(23)11-18(22)12-20(24)25/h8-9,16,18-19,22-23H,3-7,10-13H2,1-2H3,(H,24,25)/p-1/t18-,19?/m1/s1 |
| InChIKey | WFHBTYFDIZWFDG-MRTLOADZSA-M |
| XLogP | 2.06 |
| TPSA | 89.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.47 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |