About (1E)-N-[2,6-di(propan-2-yl)phenoxy]sulfonyl-1-ethoxymethanimidate
(1E)-N-[2,6-di(propan-2-yl)phenoxy]sulfonyl-1-ethoxymethanimidate (PubChem CID 91929423) has the molecular formula C15H22NO5S-
and a molecular weight of 328.41 g/mol. Its IUPAC name is (1E)-N-[2,6-di(propan-2-yl)phenoxy]sulfonyl-1-ethoxymethanimidate.
Molecular Properties
| Compound Name | (1E)-N-[2,6-di(propan-2-yl)phenoxy]sulfonyl-1-ethoxymethanimidate |
| PubChem CID | 91929423 |
| Molecular Formula | C15H22NO5S- |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | (1E)-N-[2,6-di(propan-2-yl)phenoxy]sulfonyl-1-ethoxymethanimidate |
| SMILES | CCO/C([O-])=N/S(=O)(=O)Oc1c(C(C)C)cccc1C(C)C |
| InChI | InChI=1S/C15H23NO5S/c1-6-20-15(17)16-22(18,19)21-14-12(10(2)3)8-7-9-13(14)11(4)5/h7-11H,6H2,1-5H3,(H,16,17)/p-1 |
| InChIKey | KMVORWYAUZSUNL-UHFFFAOYSA-M |
| XLogP | 2.31 |
| TPSA | 88.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze (1E)-N-[2,6-di(propan-2-yl)phenoxy]sulfonyl-1-ethoxymethanimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1E)-N-[2,6-di(propan-2-yl)phenoxy]sulfonyl-1-ethoxymethanimidate?
The IUPAC name of (1E)-N-[2,6-di(propan-2-yl)phenoxy]sulfonyl-1-ethoxymethanimidate (CID 91929423) is (1E)-N-[2,6-di(propan-2-yl)phenoxy]sulfonyl-1-ethoxymethanimidate.
What is the SMILES notation for (1E)-N-[2,6-di(propan-2-yl)phenoxy]sulfonyl-1-ethoxymethanimidate?
The canonical SMILES for (1E)-N-[2,6-di(propan-2-yl)phenoxy]sulfonyl-1-ethoxymethanimidate is CCO/C([O-])=N/S(=O)(=O)Oc1c(C(C)C)cccc1C(C)C.
What is the InChIKey of (1E)-N-[2,6-di(propan-2-yl)phenoxy]sulfonyl-1-ethoxymethanimidate?
The InChIKey is KMVORWYAUZSUNL-UHFFFAOYSA-M. The full InChI is InChI=1S/C15H23NO5S/c1-6-20-15(17)16-22(18,19)21-14-12(10(2)3)8-7-9-13(14)11(4)5/h7-11H,6H2,1-5H3,(H,16,17)/p-1.
What are the key properties of (1E)-N-[2,6-di(propan-2-yl)phenoxy]sulfonyl-1-ethoxymethanimidate?
(1E)-N-[2,6-di(propan-2-yl)phenoxy]sulfonyl-1-ethoxymethanimidate has a molecular weight of 328.41 g/mol, XLogP of 2.31, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (1E)-N-[2,6-di(propan-2-yl)phenoxy]sulfonyl-1-ethoxymethanimidate is sourced from PubChem (CID 91929423), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).