C17H22N6O3S+2 — CID 91929600
[amino-[4-[[2-[[4-[amino(azaniumylidene)methyl]phenyl]methylamino]-2-oxoethyl]sulfamoyl]phenyl]methylidene]azanium (PubChem CID 91929600) has the molecular formula C17H22N6O3S+2 and a molecular weight of 390.47 g/mol. Its IUPAC name is [amino-[4-[[2-[[4-[amino(azaniumylidene)methyl]phenyl]methylamino]-2-oxoethyl]sulfamoyl]phenyl]methylidene]azanium.
| Compound Name | [amino-[4-[[2-[[4-[amino(azaniumylidene)methyl]phenyl]methylamino]-2-oxoethyl]sulfamoyl]phenyl]methylidene]azanium |
|---|---|
| PubChem CID | 91929600 |
| Molecular Formula | C17H22N6O3S+2 |
| Molecular Weight | 390.47 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | [amino-[4-[[2-[[4-[amino(azaniumylidene)methyl]phenyl]methylamino]-2-oxoethyl]sulfamoyl]phenyl]methylidene]azanium |
| SMILES | NC(=[NH2+])c1ccc(CNC(=O)CNS(=O)(=O)c2ccc(C(N)=[NH2+])cc2)cc1 |
| InChI | InChI=1S/C17H20N6O3S/c18-16(19)12-3-1-11(2-4-12)9-22-15(24)10-23-27(25,26)14-7-5-13(6-8-14)17(20)21/h1-8,23H,9-10H2,(H3,18,19)(H3,20,21)(H,22,24)/p+2 |
| InChIKey | WMIMWMNHFQUPSP-UHFFFAOYSA-P |
| XLogP | -3.79 |
| TPSA | 178.49 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.47 |
| LogP ≤ 5 | -3.79 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|