About 1-amino-9,10-dioxo-4-[(8-sulfonatonaphthalen-1-yl)amino]anthracene-2-sulfonate
1-amino-9,10-dioxo-4-[(8-sulfonatonaphthalen-1-yl)amino]anthracene-2-sulfonate (PubChem CID 91929994) has the molecular formula C24H14N2O8S2-2
and a molecular weight of 522.52 g/mol. Its IUPAC name is 1-amino-9,10-dioxo-4-[(8-sulfonatonaphthalen-1-yl)amino]anthracene-2-sulfonate.
Molecular Properties
| Compound Name | 1-amino-9,10-dioxo-4-[(8-sulfonatonaphthalen-1-yl)amino]anthracene-2-sulfonate |
| PubChem CID | 91929994 |
| Molecular Formula | C24H14N2O8S2-2 |
| Molecular Weight | 522.52 g/mol |
| Exact Mass | 522.02 |
| IUPAC Name | 1-amino-9,10-dioxo-4-[(8-sulfonatonaphthalen-1-yl)amino]anthracene-2-sulfonate |
| SMILES | Nc1c(S(=O)(=O)[O-])cc(Nc2cccc3cccc(S(=O)(=O)[O-])c23)c2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C24H16N2O8S2/c25-22-18(36(32,33)34)11-16(20-21(22)24(28)14-8-2-1-7-13(14)23(20)27)26-15-9-3-5-12-6-4-10-17(19(12)15)35(29,30)31/h1-11,26H,25H2,(H,29,30,31)(H,32,33,34)/p-2 |
| InChIKey | NTBCAROUKFLROZ-UHFFFAOYSA-L |
| XLogP | 2.75 |
| TPSA | 186.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 522.52 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 1-amino-9,10-dioxo-4-[(8-sulfonatonaphthalen-1-yl)amino]anthracene-2-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-amino-9,10-dioxo-4-[(8-sulfonatonaphthalen-1-yl)amino]anthracene-2-sulfonate?
The IUPAC name of 1-amino-9,10-dioxo-4-[(8-sulfonatonaphthalen-1-yl)amino]anthracene-2-sulfonate (CID 91929994) is 1-amino-9,10-dioxo-4-[(8-sulfonatonaphthalen-1-yl)amino]anthracene-2-sulfonate.
What is the SMILES notation for 1-amino-9,10-dioxo-4-[(8-sulfonatonaphthalen-1-yl)amino]anthracene-2-sulfonate?
The canonical SMILES for 1-amino-9,10-dioxo-4-[(8-sulfonatonaphthalen-1-yl)amino]anthracene-2-sulfonate is Nc1c(S(=O)(=O)[O-])cc(Nc2cccc3cccc(S(=O)(=O)[O-])c23)c2c1C(=O)c1ccccc1C2=O.
What is the InChIKey of 1-amino-9,10-dioxo-4-[(8-sulfonatonaphthalen-1-yl)amino]anthracene-2-sulfonate?
The InChIKey is NTBCAROUKFLROZ-UHFFFAOYSA-L. The full InChI is InChI=1S/C24H16N2O8S2/c25-22-18(36(32,33)34)11-16(20-21(22)24(28)14-8-2-1-7-13(14)23(20)27)26-15-9-3-5-12-6-4-10-17(19(12)15)35(29,30)31/h1-11,26H,25H2,(H,29,30,31)(H,32,33,34)/p-2.
What are the key properties of 1-amino-9,10-dioxo-4-[(8-sulfonatonaphthalen-1-yl)amino]anthracene-2-sulfonate?
1-amino-9,10-dioxo-4-[(8-sulfonatonaphthalen-1-yl)amino]anthracene-2-sulfonate has a molecular weight of 522.52 g/mol, XLogP of 2.75, 4 rotatable bonds, 2 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-9,10-dioxo-4-[(8-sulfonatonaphthalen-1-yl)amino]anthracene-2-sulfonate is sourced from PubChem (CID 91929994), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).