C22H15N2O6S- — CID 91930081
4-(4-acetylanilino)-1-amino-9,10-dioxoanthracene-2-sulfonate (PubChem CID 91930081) has the molecular formula C22H15N2O6S- and a molecular weight of 435.44 g/mol. Its IUPAC name is 4-(4-acetylanilino)-1-amino-9,10-dioxoanthracene-2-sulfonate.
| Compound Name | 4-(4-acetylanilino)-1-amino-9,10-dioxoanthracene-2-sulfonate |
|---|---|
| PubChem CID | 91930081 |
| Molecular Formula | C22H15N2O6S- |
| Molecular Weight | 435.44 g/mol |
| Exact Mass | 435.07 |
| IUPAC Name | 4-(4-acetylanilino)-1-amino-9,10-dioxoanthracene-2-sulfonate |
| SMILES | CC(=O)c1ccc(Nc2cc(S(=O)(=O)[O-])c(N)c3c2C(=O)c2ccccc2C3=O)cc1 |
| InChI | InChI=1S/C22H16N2O6S/c1-11(25)12-6-8-13(9-7-12)24-16-10-17(31(28,29)30)20(23)19-18(16)21(26)14-4-2-3-5-15(14)22(19)27/h2-10,24H,23H2,1H3,(H,28,29,30)/p-1 |
| InChIKey | VRZCMDBDQUYYIB-UHFFFAOYSA-M |
| XLogP | 2.89 |
| TPSA | 146.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.44 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|