About 2-[(4R)-4-ethyl-2,2-dimethyl-1,3-oxazolidin-4-yl]ethyl acetate
2-[(4R)-4-ethyl-2,2-dimethyl-1,3-oxazolidin-4-yl]ethyl acetate (PubChem CID 91930405) has the molecular formula C11H21NO3
and a molecular weight of 215.29 g/mol. Its IUPAC name is 2-[(4R)-4-ethyl-2,2-dimethyl-1,3-oxazolidin-4-yl]ethyl acetate.
Analyze 2-[(4R)-4-ethyl-2,2-dimethyl-1,3-oxazolidin-4-yl]ethyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4R)-4-ethyl-2,2-dimethyl-1,3-oxazolidin-4-yl]ethyl acetate?
The IUPAC name of 2-[(4R)-4-ethyl-2,2-dimethyl-1,3-oxazolidin-4-yl]ethyl acetate (CID 91930405) is 2-[(4R)-4-ethyl-2,2-dimethyl-1,3-oxazolidin-4-yl]ethyl acetate.
What is the SMILES notation for 2-[(4R)-4-ethyl-2,2-dimethyl-1,3-oxazolidin-4-yl]ethyl acetate?
The canonical SMILES for 2-[(4R)-4-ethyl-2,2-dimethyl-1,3-oxazolidin-4-yl]ethyl acetate is CC[C@@]1(CCOC(C)=O)COC(C)(C)N1.
What is the InChIKey of 2-[(4R)-4-ethyl-2,2-dimethyl-1,3-oxazolidin-4-yl]ethyl acetate?
The InChIKey is OHJFJJQJAMDKFF-LLVKDONJSA-N. The full InChI is InChI=1S/C11H21NO3/c1-5-11(6-7-14-9(2)13)8-15-10(3,4)12-11/h12H,5-8H2,1-4H3/t11-/m1/s1.
What are the key properties of 2-[(4R)-4-ethyl-2,2-dimethyl-1,3-oxazolidin-4-yl]ethyl acetate?
2-[(4R)-4-ethyl-2,2-dimethyl-1,3-oxazolidin-4-yl]ethyl acetate has a molecular weight of 215.29 g/mol, XLogP of 1.44, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4R)-4-ethyl-2,2-dimethyl-1,3-oxazolidin-4-yl]ethyl acetate is sourced from PubChem (CID 91930405), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).