C17H17N7O — CID 91930533
4-[[[4-anilino-6-(methylamino)-1,3,5-triazin-2-yl]diazenyl]methyl]phenol (PubChem CID 91930533) has the molecular formula C17H17N7O and a molecular weight of 335.37 g/mol. Its IUPAC name is 4-[[[4-anilino-6-(methylamino)-1,3,5-triazin-2-yl]diazenyl]methyl]phenol.
| Compound Name | 4-[[[4-anilino-6-(methylamino)-1,3,5-triazin-2-yl]diazenyl]methyl]phenol |
|---|---|
| PubChem CID | 91930533 |
| Molecular Formula | C17H17N7O |
| Molecular Weight | 335.37 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | 4-[[[4-anilino-6-(methylamino)-1,3,5-triazin-2-yl]diazenyl]methyl]phenol |
| SMILES | CNc1nc(/N=N/Cc2ccc(O)cc2)nc(Nc2ccccc2)n1 |
| InChI | InChI=1S/C17H17N7O/c1-18-15-21-16(20-13-5-3-2-4-6-13)23-17(22-15)24-19-11-12-7-9-14(25)10-8-12/h2-10,25H,11H2,1H3,(H2,18,20,21,22,23)/b24-19+ |
| InChIKey | RQAULCNXGFWVJF-LYBHJNIJSA-N |
| XLogP | 3.65 |
| TPSA | 107.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.37 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|