About 1-(1,3-thiazol-2-yl)-4-(thiophene-2-carbonyl)-5-thiophen-2-ylpyrrolidine-2,3-dione
1-(1,3-thiazol-2-yl)-4-(thiophene-2-carbonyl)-5-thiophen-2-ylpyrrolidine-2,3-dione (PubChem CID 91930621) has the molecular formula C16H10N2O3S3
and a molecular weight of 374.47 g/mol. Its IUPAC name is 1-(1,3-thiazol-2-yl)-4-(thiophene-2-carbonyl)-5-thiophen-2-ylpyrrolidine-2,3-dione.
Molecular Properties
| Compound Name | 1-(1,3-thiazol-2-yl)-4-(thiophene-2-carbonyl)-5-thiophen-2-ylpyrrolidine-2,3-dione |
| PubChem CID | 91930621 |
| Molecular Formula | C16H10N2O3S3 |
| Molecular Weight | 374.47 g/mol |
| Exact Mass | 373.99 |
| IUPAC Name | 1-(1,3-thiazol-2-yl)-4-(thiophene-2-carbonyl)-5-thiophen-2-ylpyrrolidine-2,3-dione |
| SMILES | O=C1C(=O)N(c2nccs2)C(c2cccs2)C1C(=O)c1cccs1 |
| InChI | InChI=1S/C16H10N2O3S3/c19-13(10-4-2-7-23-10)11-12(9-3-1-6-22-9)18(15(21)14(11)20)16-17-5-8-24-16/h1-8,11-12H |
| InChIKey | UROSSQCXPFRKPA-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 67.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.47 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 1-(1,3-thiazol-2-yl)-4-(thiophene-2-carbonyl)-5-thiophen-2-ylpyrrolidine-2,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,3-thiazol-2-yl)-4-(thiophene-2-carbonyl)-5-thiophen-2-ylpyrrolidine-2,3-dione?
The IUPAC name of 1-(1,3-thiazol-2-yl)-4-(thiophene-2-carbonyl)-5-thiophen-2-ylpyrrolidine-2,3-dione (CID 91930621) is 1-(1,3-thiazol-2-yl)-4-(thiophene-2-carbonyl)-5-thiophen-2-ylpyrrolidine-2,3-dione.
What is the SMILES notation for 1-(1,3-thiazol-2-yl)-4-(thiophene-2-carbonyl)-5-thiophen-2-ylpyrrolidine-2,3-dione?
The canonical SMILES for 1-(1,3-thiazol-2-yl)-4-(thiophene-2-carbonyl)-5-thiophen-2-ylpyrrolidine-2,3-dione is O=C1C(=O)N(c2nccs2)C(c2cccs2)C1C(=O)c1cccs1.
What is the InChIKey of 1-(1,3-thiazol-2-yl)-4-(thiophene-2-carbonyl)-5-thiophen-2-ylpyrrolidine-2,3-dione?
The InChIKey is UROSSQCXPFRKPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10N2O3S3/c19-13(10-4-2-7-23-10)11-12(9-3-1-6-22-9)18(15(21)14(11)20)16-17-5-8-24-16/h1-8,11-12H.
What are the key properties of 1-(1,3-thiazol-2-yl)-4-(thiophene-2-carbonyl)-5-thiophen-2-ylpyrrolidine-2,3-dione?
1-(1,3-thiazol-2-yl)-4-(thiophene-2-carbonyl)-5-thiophen-2-ylpyrrolidine-2,3-dione has a molecular weight of 374.47 g/mol, XLogP of 3.42, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,3-thiazol-2-yl)-4-(thiophene-2-carbonyl)-5-thiophen-2-ylpyrrolidine-2,3-dione is sourced from PubChem (CID 91930621), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).