C11H11N2O6S- — CID 91931078
(2S,3S,5R,6R)-3-[(E)-2-cyanoethenyl]-6-(hydroxymethyl)-3-methyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 91931078) has the molecular formula C11H11N2O6S- and a molecular weight of 299.28 g/mol. Its IUPAC name is (2S,3S,5R,6R)-3-[(E)-2-cyanoethenyl]-6-(hydroxymethyl)-3-methyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | (2S,3S,5R,6R)-3-[(E)-2-cyanoethenyl]-6-(hydroxymethyl)-3-methyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 91931078 |
| Molecular Formula | C11H11N2O6S- |
| Molecular Weight | 299.28 g/mol |
| Exact Mass | 299.03 |
| IUPAC Name | (2S,3S,5R,6R)-3-[(E)-2-cyanoethenyl]-6-(hydroxymethyl)-3-methyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | C[C@]1(/C=C/C#N)[C@H](C(=O)[O-])N2C(=O)[C@@H](CO)[C@H]2S1(=O)=O |
| InChI | InChI=1S/C11H12N2O6S/c1-11(3-2-4-12)7(10(16)17)13-8(15)6(5-14)9(13)20(11,18)19/h2-3,6-7,9,14H,5H2,1H3,(H,16,17)/p-1/b3-2+/t6-,7+,9-,11+/m1/s1 |
| InChIKey | NZNHTQCXWOAKDT-SURRTWTPSA-M |
| XLogP | -2.85 |
| TPSA | 138.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.28 |
| LogP ≤ 5 | -2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|