C12H8N2O7S-2 — CID 91931141
(2S,3S,6Z)-6-(carboxylatomethylidene)-3-[(E)-2-cyanoethenyl]-3-methyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 91931141) has the molecular formula C12H8N2O7S-2 and a molecular weight of 324.27 g/mol. Its IUPAC name is (2S,3S,6Z)-6-(carboxylatomethylidene)-3-[(E)-2-cyanoethenyl]-3-methyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | (2S,3S,6Z)-6-(carboxylatomethylidene)-3-[(E)-2-cyanoethenyl]-3-methyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 91931141 |
| Molecular Formula | C12H8N2O7S-2 |
| Molecular Weight | 324.27 g/mol |
| Exact Mass | 324.01 |
| IUPAC Name | (2S,3S,6Z)-6-(carboxylatomethylidene)-3-[(E)-2-cyanoethenyl]-3-methyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | C[C@]1(/C=C/C#N)[C@H](C(=O)[O-])N2C(=O)/C(=C/C(=O)[O-])C2S1(=O)=O |
| InChI | InChI=1S/C12H10N2O7S/c1-12(3-2-4-13)8(11(18)19)14-9(17)6(5-7(15)16)10(14)22(12,20)21/h2-3,5,8,10H,1H3,(H,15,16)(H,18,19)/p-2/b3-2+,6-5-/t8-,10?,12-/m0/s1 |
| InChIKey | AMADWCSEABPIKZ-XOKGFBIYSA-L |
| XLogP | -3.78 |
| TPSA | 158.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.27 |
| LogP ≤ 5 | -3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|