C13H21NO2 — CID 91932523
(7S,7aS)-7,7a-dimethylspiro[6,7-dihydro-1H-pyrrolo[1,2-c][1,3]oxazole-3,1'-cyclohexane]-5-one (PubChem CID 91932523) has the molecular formula C13H21NO2 and a molecular weight of 223.32 g/mol. Its IUPAC name is (7S,7aS)-7,7a-dimethylspiro[6,7-dihydro-1H-pyrrolo[1,2-c][1,3]oxazole-3,1'-cyclohexane]-5-one.
| Compound Name | (7S,7aS)-7,7a-dimethylspiro[6,7-dihydro-1H-pyrrolo[1,2-c][1,3]oxazole-3,1'-cyclohexane]-5-one |
|---|---|
| PubChem CID | 91932523 |
| Molecular Formula | C13H21NO2 |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.16 |
| IUPAC Name | (7S,7aS)-7,7a-dimethylspiro[6,7-dihydro-1H-pyrrolo[1,2-c][1,3]oxazole-3,1'-cyclohexane]-5-one |
| SMILES | C[C@H]1CC(=O)N2C3(CCCCC3)OC[C@]12C |
| InChI | InChI=1S/C13H21NO2/c1-10-8-11(15)14-12(10,2)9-16-13(14)6-4-3-5-7-13/h10H,3-9H2,1-2H3/t10-,12+/m0/s1 |
| InChIKey | NOJHSEGBJWTAIJ-CMPLNLGQSA-N |
| XLogP | 2.30 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |