C25H29F3N2O5 — CID 91932529
2,2,2-trifluoroethyl 2-[(5R,7aS)-7a-[2-(1,3-dioxoisoindol-2-yl)ethyl]spiro[1,5,6,7-tetrahydropyrrolo[1,2-c][1,3]oxazole-3,1'-cyclohexane]-5-yl]acetate (PubChem CID 91932529) has the molecular formula C25H29F3N2O5 and a molecular weight of 494.51 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl 2-[(5R,7aS)-7a-[2-(1,3-dioxoisoindol-2-yl)ethyl]spiro[1,5,6,7-tetrahydropyrrolo[1,2-c][1,3]oxazole-3,1'-cyclohexane]-5-yl]acetate.
| Compound Name | 2,2,2-trifluoroethyl 2-[(5R,7aS)-7a-[2-(1,3-dioxoisoindol-2-yl)ethyl]spiro[1,5,6,7-tetrahydropyrrolo[1,2-c][1,3]oxazole-3,1'-cyclohexane]-5-yl]acetate |
|---|---|
| PubChem CID | 91932529 |
| Molecular Formula | C25H29F3N2O5 |
| Molecular Weight | 494.51 g/mol |
| Exact Mass | 494.20 |
| IUPAC Name | 2,2,2-trifluoroethyl 2-[(5R,7aS)-7a-[2-(1,3-dioxoisoindol-2-yl)ethyl]spiro[1,5,6,7-tetrahydropyrrolo[1,2-c][1,3]oxazole-3,1'-cyclohexane]-5-yl]acetate |
| SMILES | O=C(C[C@H]1CC[C@]2(CCN3C(=O)c4ccccc4C3=O)COC3(CCCCC3)N12)OCC(F)(F)F |
| InChI | InChI=1S/C25H29F3N2O5/c26-25(27,28)16-34-20(31)14-17-8-11-23(15-35-24(30(17)23)9-4-1-5-10-24)12-13-29-21(32)18-6-2-3-7-19(18)22(29)33/h2-3,6-7,17H,1,4-5,8-16H2/t17-,23+/m1/s1 |
| InChIKey | FYNHYESQIRNJRG-HXOBKFHXSA-N |
| XLogP | 4.06 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.51 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|