C7H12ClF2N — CID 91933766
(3aS,6aR)-5,5-difluoro-2,3,3a,4,6,6a-hexahydro-1H-cyclopenta[c]pyrrole;hydrochloride (PubChem CID 91933766) has the molecular formula C7H12ClF2N and a molecular weight of 183.63 g/mol. Its IUPAC name is (3aS,6aR)-5,5-difluoro-2,3,3a,4,6,6a-hexahydro-1H-cyclopenta[c]pyrrole;hydrochloride.
| Compound Name | (3aS,6aR)-5,5-difluoro-2,3,3a,4,6,6a-hexahydro-1H-cyclopenta[c]pyrrole;hydrochloride |
|---|---|
| PubChem CID | 91933766 |
| Molecular Formula | C7H12ClF2N |
| Molecular Weight | 183.63 g/mol |
| Exact Mass | 183.06 |
| IUPAC Name | (3aS,6aR)-5,5-difluoro-2,3,3a,4,6,6a-hexahydro-1H-cyclopenta[c]pyrrole;hydrochloride |
| SMILES | Cl.FC1(F)C[C@H]2CNC[C@H]2C1 |
| InChI | InChI=1S/C7H11F2N.ClH/c8-7(9)1-5-3-10-4-6(5)2-7;/h5-6,10H,1-4H2;1H/t5-,6+; |
| InChIKey | VDNXSLMZLQNXAC-KNCHESJLSA-N |
| XLogP | 1.67 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.63 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |