About (2-carboxy-3,4-dihydro-2H-pyrrol-5-yl)-trihydroxyphosphanium
(2-carboxy-3,4-dihydro-2H-pyrrol-5-yl)-trihydroxyphosphanium (PubChem CID 91934485) has the molecular formula C5H9NO5P+
and a molecular weight of 194.10 g/mol. Its IUPAC name is (2-carboxy-3,4-dihydro-2H-pyrrol-5-yl)-trihydroxyphosphanium.
Molecular Properties
| Compound Name | (2-carboxy-3,4-dihydro-2H-pyrrol-5-yl)-trihydroxyphosphanium |
| PubChem CID | 91934485 |
| Molecular Formula | C5H9NO5P+ |
| Molecular Weight | 194.10 g/mol |
| Exact Mass | 194.02 |
| IUPAC Name | (2-carboxy-3,4-dihydro-2H-pyrrol-5-yl)-trihydroxyphosphanium |
| SMILES | O=C(O)C1CCC([P+](O)(O)O)=N1 |
| InChI | InChI=1S/C5H8NO5P/c7-5(8)3-1-2-4(6-3)12(9,10)11/h3,9-11H,1-2H2/p+1 |
| InChIKey | IBNWFGOLBHHXRH-UHFFFAOYSA-O |
| XLogP | -0.63 |
| TPSA | 110.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.10 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (2-carboxy-3,4-dihydro-2H-pyrrol-5-yl)-trihydroxyphosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-carboxy-3,4-dihydro-2H-pyrrol-5-yl)-trihydroxyphosphanium?
The IUPAC name of (2-carboxy-3,4-dihydro-2H-pyrrol-5-yl)-trihydroxyphosphanium (CID 91934485) is (2-carboxy-3,4-dihydro-2H-pyrrol-5-yl)-trihydroxyphosphanium.
What is the SMILES notation for (2-carboxy-3,4-dihydro-2H-pyrrol-5-yl)-trihydroxyphosphanium?
The canonical SMILES for (2-carboxy-3,4-dihydro-2H-pyrrol-5-yl)-trihydroxyphosphanium is O=C(O)C1CCC([P+](O)(O)O)=N1.
What is the InChIKey of (2-carboxy-3,4-dihydro-2H-pyrrol-5-yl)-trihydroxyphosphanium?
The InChIKey is IBNWFGOLBHHXRH-UHFFFAOYSA-O. The full InChI is InChI=1S/C5H8NO5P/c7-5(8)3-1-2-4(6-3)12(9,10)11/h3,9-11H,1-2H2/p+1.
What are the key properties of (2-carboxy-3,4-dihydro-2H-pyrrol-5-yl)-trihydroxyphosphanium?
(2-carboxy-3,4-dihydro-2H-pyrrol-5-yl)-trihydroxyphosphanium has a molecular weight of 194.10 g/mol, XLogP of -0.63, 2 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-carboxy-3,4-dihydro-2H-pyrrol-5-yl)-trihydroxyphosphanium is sourced from PubChem (CID 91934485), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).