C24H28O6 — CID 91934956
6,7-dihydroxy-3-methoxy-4-(2-methylbut-3-en-2-yl)-8-(3-methylbut-2-enyl)-4a,9a-dihydro-2H-xanthene-1,9-dione (PubChem CID 91934956) has the molecular formula C24H28O6 and a molecular weight of 412.48 g/mol. Its IUPAC name is 6,7-dihydroxy-3-methoxy-4-(2-methylbut-3-en-2-yl)-8-(3-methylbut-2-enyl)-4a,9a-dihydro-2H-xanthene-1,9-dione.
| Compound Name | 6,7-dihydroxy-3-methoxy-4-(2-methylbut-3-en-2-yl)-8-(3-methylbut-2-enyl)-4a,9a-dihydro-2H-xanthene-1,9-dione |
|---|---|
| PubChem CID | 91934956 |
| Molecular Formula | C24H28O6 |
| Molecular Weight | 412.48 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | 6,7-dihydroxy-3-methoxy-4-(2-methylbut-3-en-2-yl)-8-(3-methylbut-2-enyl)-4a,9a-dihydro-2H-xanthene-1,9-dione |
| SMILES | C=CC(C)(C)C1=C(OC)CC(=O)C2C(=O)c3c(cc(O)c(O)c3CC=C(C)C)OC12 |
| InChI | InChI=1S/C24H28O6/c1-7-24(4,5)20-17(29-6)10-14(25)19-22(28)18-13(9-8-12(2)3)21(27)15(26)11-16(18)30-23(19)20/h7-8,11,19,23,26-27H,1,9-10H2,2-6H3 |
| InChIKey | ZRUQMQBACPRHDL-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.48 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|