About 4-[(pyridin-2-yldiazenyl)methyl]benzene-1,2,3-triol
4-[(pyridin-2-yldiazenyl)methyl]benzene-1,2,3-triol (PubChem CID 91935009) has the molecular formula C12H11N3O3
and a molecular weight of 245.24 g/mol. Its IUPAC name is 4-[(pyridin-2-yldiazenyl)methyl]benzene-1,2,3-triol.
Molecular Properties
| Compound Name | 4-[(pyridin-2-yldiazenyl)methyl]benzene-1,2,3-triol |
| PubChem CID | 91935009 |
| Molecular Formula | C12H11N3O3 |
| Molecular Weight | 245.24 g/mol |
| Exact Mass | 245.08 |
| IUPAC Name | 4-[(pyridin-2-yldiazenyl)methyl]benzene-1,2,3-triol |
| SMILES | Oc1ccc(C/N=N/c2ccccn2)c(O)c1O |
| InChI | InChI=1S/C12H11N3O3/c16-9-5-4-8(11(17)12(9)18)7-14-15-10-3-1-2-6-13-10/h1-6,16-18H,7H2/b15-14+ |
| InChIKey | RTTWMCUAAUCGHU-CCEZHUSRSA-N |
| XLogP | 2.48 |
| TPSA | 98.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.24 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 4-[(pyridin-2-yldiazenyl)methyl]benzene-1,2,3-triol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(pyridin-2-yldiazenyl)methyl]benzene-1,2,3-triol?
The IUPAC name of 4-[(pyridin-2-yldiazenyl)methyl]benzene-1,2,3-triol (CID 91935009) is 4-[(pyridin-2-yldiazenyl)methyl]benzene-1,2,3-triol.
What is the SMILES notation for 4-[(pyridin-2-yldiazenyl)methyl]benzene-1,2,3-triol?
The canonical SMILES for 4-[(pyridin-2-yldiazenyl)methyl]benzene-1,2,3-triol is Oc1ccc(C/N=N/c2ccccn2)c(O)c1O.
What is the InChIKey of 4-[(pyridin-2-yldiazenyl)methyl]benzene-1,2,3-triol?
The InChIKey is RTTWMCUAAUCGHU-CCEZHUSRSA-N. The full InChI is InChI=1S/C12H11N3O3/c16-9-5-4-8(11(17)12(9)18)7-14-15-10-3-1-2-6-13-10/h1-6,16-18H,7H2/b15-14+.
What are the key properties of 4-[(pyridin-2-yldiazenyl)methyl]benzene-1,2,3-triol?
4-[(pyridin-2-yldiazenyl)methyl]benzene-1,2,3-triol has a molecular weight of 245.24 g/mol, XLogP of 2.48, 3 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(pyridin-2-yldiazenyl)methyl]benzene-1,2,3-triol is sourced from PubChem (CID 91935009), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).