C27H30O4 — CID 91935416
8-(1-oxospiro[4,9-dihydro-2H-xanthene-3,1'-cyclopentane]-9-yl)spiro[4.5]decane-7,9-dione (PubChem CID 91935416) has the molecular formula C27H30O4 and a molecular weight of 418.53 g/mol. Its IUPAC name is 8-(1-oxospiro[4,9-dihydro-2H-xanthene-3,1'-cyclopentane]-9-yl)spiro[4.5]decane-7,9-dione.
| Compound Name | 8-(1-oxospiro[4,9-dihydro-2H-xanthene-3,1'-cyclopentane]-9-yl)spiro[4.5]decane-7,9-dione |
|---|---|
| PubChem CID | 91935416 |
| Molecular Formula | C27H30O4 |
| Molecular Weight | 418.53 g/mol |
| Exact Mass | 418.21 |
| IUPAC Name | 8-(1-oxospiro[4,9-dihydro-2H-xanthene-3,1'-cyclopentane]-9-yl)spiro[4.5]decane-7,9-dione |
| SMILES | O=C1CC2(CCCC2)CC2=C1C(C1C(=O)CC3(CCCC3)CC1=O)c1ccccc1O2 |
| InChI | InChI=1S/C27H30O4/c28-18-13-26(9-3-4-10-26)14-19(29)24(18)23-17-7-1-2-8-21(17)31-22-16-27(11-5-6-12-27)15-20(30)25(22)23/h1-2,7-8,23-24H,3-6,9-16H2 |
| InChIKey | XVXPDHYFKLPDJW-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.53 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|