About 4-[4-[(2,4-dimethyl-3,5-dioxothiolan-2-yl)methyl]phenyl]benzamide
4-[4-[(2,4-dimethyl-3,5-dioxothiolan-2-yl)methyl]phenyl]benzamide (PubChem CID 91935604) has the molecular formula C20H19NO3S
and a molecular weight of 353.44 g/mol. Its IUPAC name is 4-[4-[(2,4-dimethyl-3,5-dioxothiolan-2-yl)methyl]phenyl]benzamide.
Molecular Properties
| Compound Name | 4-[4-[(2,4-dimethyl-3,5-dioxothiolan-2-yl)methyl]phenyl]benzamide |
| PubChem CID | 91935604 |
| Molecular Formula | C20H19NO3S |
| Molecular Weight | 353.44 g/mol |
| Exact Mass | 353.11 |
| IUPAC Name | 4-[4-[(2,4-dimethyl-3,5-dioxothiolan-2-yl)methyl]phenyl]benzamide |
| SMILES | CC1C(=O)SC(C)(Cc2ccc(-c3ccc(C(N)=O)cc3)cc2)C1=O |
| InChI | InChI=1S/C20H19NO3S/c1-12-17(22)20(2,25-19(12)24)11-13-3-5-14(6-4-13)15-7-9-16(10-8-15)18(21)23/h3-10,12H,11H2,1-2H3,(H2,21,23) |
| InChIKey | JVOIFHQOWOVREC-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.44 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze 4-[4-[(2,4-dimethyl-3,5-dioxothiolan-2-yl)methyl]phenyl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-[(2,4-dimethyl-3,5-dioxothiolan-2-yl)methyl]phenyl]benzamide?
The IUPAC name of 4-[4-[(2,4-dimethyl-3,5-dioxothiolan-2-yl)methyl]phenyl]benzamide (CID 91935604) is 4-[4-[(2,4-dimethyl-3,5-dioxothiolan-2-yl)methyl]phenyl]benzamide.
What is the SMILES notation for 4-[4-[(2,4-dimethyl-3,5-dioxothiolan-2-yl)methyl]phenyl]benzamide?
The canonical SMILES for 4-[4-[(2,4-dimethyl-3,5-dioxothiolan-2-yl)methyl]phenyl]benzamide is CC1C(=O)SC(C)(Cc2ccc(-c3ccc(C(N)=O)cc3)cc2)C1=O.
What is the InChIKey of 4-[4-[(2,4-dimethyl-3,5-dioxothiolan-2-yl)methyl]phenyl]benzamide?
The InChIKey is JVOIFHQOWOVREC-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19NO3S/c1-12-17(22)20(2,25-19(12)24)11-13-3-5-14(6-4-13)15-7-9-16(10-8-15)18(21)23/h3-10,12H,11H2,1-2H3,(H2,21,23).
What are the key properties of 4-[4-[(2,4-dimethyl-3,5-dioxothiolan-2-yl)methyl]phenyl]benzamide?
4-[4-[(2,4-dimethyl-3,5-dioxothiolan-2-yl)methyl]phenyl]benzamide has a molecular weight of 353.44 g/mol, XLogP of 3.23, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-[(2,4-dimethyl-3,5-dioxothiolan-2-yl)methyl]phenyl]benzamide is sourced from PubChem (CID 91935604), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).