C17H18F3N2+ — CID 91935932
[(3R,4R)-1-phenyl-4-(2,4,5-trifluorophenyl)piperidin-3-yl]azanium (PubChem CID 91935932) has the molecular formula C17H18F3N2+ and a molecular weight of 307.34 g/mol. Its IUPAC name is [(3R,4R)-1-phenyl-4-(2,4,5-trifluorophenyl)piperidin-3-yl]azanium.
| Compound Name | [(3R,4R)-1-phenyl-4-(2,4,5-trifluorophenyl)piperidin-3-yl]azanium |
|---|---|
| PubChem CID | 91935932 |
| Molecular Formula | C17H18F3N2+ |
| Molecular Weight | 307.34 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | [(3R,4R)-1-phenyl-4-(2,4,5-trifluorophenyl)piperidin-3-yl]azanium |
| SMILES | [NH3+][C@H]1CN(c2ccccc2)CC[C@@H]1c1cc(F)c(F)cc1F |
| InChI | InChI=1S/C17H17F3N2/c18-14-9-16(20)15(19)8-13(14)12-6-7-22(10-17(12)21)11-4-2-1-3-5-11/h1-5,8-9,12,17H,6-7,10,21H2/p+1/t12-,17+/m1/s1 |
| InChIKey | QRKBNWRTCCHLLG-PXAZEXFGSA-O |
| XLogP | 2.71 |
| TPSA | 30.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.34 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|