C21H21F3N5+ — CID 91935940
[(3R,4R)-1-(4-cyclopropylpyrido[3,2-d]pyrimidin-6-yl)-4-(2,4,5-trifluorophenyl)piperidin-3-yl]azanium (PubChem CID 91935940) has the molecular formula C21H21F3N5+ and a molecular weight of 400.43 g/mol. Its IUPAC name is [(3R,4R)-1-(4-cyclopropylpyrido[3,2-d]pyrimidin-6-yl)-4-(2,4,5-trifluorophenyl)piperidin-3-yl]azanium.
| Compound Name | [(3R,4R)-1-(4-cyclopropylpyrido[3,2-d]pyrimidin-6-yl)-4-(2,4,5-trifluorophenyl)piperidin-3-yl]azanium |
|---|---|
| PubChem CID | 91935940 |
| Molecular Formula | C21H21F3N5+ |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | [(3R,4R)-1-(4-cyclopropylpyrido[3,2-d]pyrimidin-6-yl)-4-(2,4,5-trifluorophenyl)piperidin-3-yl]azanium |
| SMILES | [NH3+][C@H]1CN(c2ccc3ncnc(C4CC4)c3n2)CC[C@@H]1c1cc(F)c(F)cc1F |
| InChI | InChI=1S/C21H20F3N5/c22-14-8-16(24)15(23)7-13(14)12-5-6-29(9-17(12)25)19-4-3-18-21(28-19)20(11-1-2-11)27-10-26-18/h3-4,7-8,10-12,17H,1-2,5-6,9,25H2/p+1/t12-,17+/m1/s1 |
| InChIKey | ZLADIHAEMRLCDC-PXAZEXFGSA-O |
| XLogP | 2.92 |
| TPSA | 69.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|