C14H23N3O3S2 — CID 9193597
5-[[(3R)-1,1-dioxothiolan-3-yl]methyl]-3-[(4-methylpiperidin-1-yl)methyl]-1,3,4-oxadiazole-2-thione (PubChem CID 9193597) has the molecular formula C14H23N3O3S2 and a molecular weight of 345.49 g/mol. Its IUPAC name is 5-[[(3R)-1,1-dioxothiolan-3-yl]methyl]-3-[(4-methylpiperidin-1-yl)methyl]-1,3,4-oxadiazole-2-thione.
| Compound Name | 5-[[(3R)-1,1-dioxothiolan-3-yl]methyl]-3-[(4-methylpiperidin-1-yl)methyl]-1,3,4-oxadiazole-2-thione |
|---|---|
| PubChem CID | 9193597 |
| Molecular Formula | C14H23N3O3S2 |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | 5-[[(3R)-1,1-dioxothiolan-3-yl]methyl]-3-[(4-methylpiperidin-1-yl)methyl]-1,3,4-oxadiazole-2-thione |
| SMILES | CC1CCN(Cn2nc(C[C@@H]3CCS(=O)(=O)C3)oc2=S)CC1 |
| InChI | InChI=1S/C14H23N3O3S2/c1-11-2-5-16(6-3-11)10-17-14(21)20-13(15-17)8-12-4-7-22(18,19)9-12/h11-12H,2-10H2,1H3/t12-/m0/s1 |
| InChIKey | NDQJVIVYRXKLNC-LBPRGKRZSA-N |
| XLogP | 1.87 |
| TPSA | 68.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|