C24H26N4O3 — CID 91936065
(10R)-13-(5-aminopentyl)-14-hydroxy-10-(3-hydroxyphenyl)-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6,14-pentaen-12-one (PubChem CID 91936065) has the molecular formula C24H26N4O3 and a molecular weight of 418.50 g/mol. Its IUPAC name is (10R)-13-(5-aminopentyl)-14-hydroxy-10-(3-hydroxyphenyl)-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6,14-pentaen-12-one.
| Compound Name | (10R)-13-(5-aminopentyl)-14-hydroxy-10-(3-hydroxyphenyl)-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6,14-pentaen-12-one |
|---|---|
| PubChem CID | 91936065 |
| Molecular Formula | C24H26N4O3 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | (10R)-13-(5-aminopentyl)-14-hydroxy-10-(3-hydroxyphenyl)-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6,14-pentaen-12-one |
| SMILES | NCCCCCn1c(O)c2n(c1=O)[C@H](c1cccc(O)c1)c1[nH]c3ccccc3c1C2 |
| InChI | InChI=1S/C24H26N4O3/c25-11-4-1-5-12-27-23(30)20-14-18-17-9-2-3-10-19(17)26-21(18)22(28(20)24(27)31)15-7-6-8-16(29)13-15/h2-3,6-10,13,22,26,29-30H,1,4-5,11-12,14,25H2/t22-/m1/s1 |
| InChIKey | VDAZWZIYQWEUFD-JOCHJYFZSA-N |
| XLogP | 3.21 |
| TPSA | 109.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|