C21H24O8 — CID 91936207
4-acetyl-6-[(3-butanoyl-2,4,6-trihydroxyphenyl)methyl]-2,2-dimethylcyclohexane-1,3,5-trione (PubChem CID 91936207) has the molecular formula C21H24O8 and a molecular weight of 404.42 g/mol. Its IUPAC name is 4-acetyl-6-[(3-butanoyl-2,4,6-trihydroxyphenyl)methyl]-2,2-dimethylcyclohexane-1,3,5-trione.
| Compound Name | 4-acetyl-6-[(3-butanoyl-2,4,6-trihydroxyphenyl)methyl]-2,2-dimethylcyclohexane-1,3,5-trione |
|---|---|
| PubChem CID | 91936207 |
| Molecular Formula | C21H24O8 |
| Molecular Weight | 404.42 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | 4-acetyl-6-[(3-butanoyl-2,4,6-trihydroxyphenyl)methyl]-2,2-dimethylcyclohexane-1,3,5-trione |
| SMILES | CCCC(=O)c1c(O)cc(O)c(CC2C(=O)C(C(C)=O)C(=O)C(C)(C)C2=O)c1O |
| InChI | InChI=1S/C21H24O8/c1-5-6-12(23)16-14(25)8-13(24)10(17(16)26)7-11-18(27)15(9(2)22)20(29)21(3,4)19(11)28/h8,11,15,24-26H,5-7H2,1-4H3 |
| InChIKey | ZNPQBLOHBHIMRJ-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 146.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.42 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|