About 4-hydroxybenzoic acid;pyridine-3-carboxamide
4-hydroxybenzoic acid;pyridine-3-carboxamide (PubChem CID 91936866) has the molecular formula C13H12N2O4
and a molecular weight of 260.25 g/mol. Its IUPAC name is 4-hydroxybenzoic acid;pyridine-3-carboxamide.
Molecular Properties
| Compound Name | 4-hydroxybenzoic acid;pyridine-3-carboxamide |
| PubChem CID | 91936866 |
| Molecular Formula | C13H12N2O4 |
| Molecular Weight | 260.25 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | 4-hydroxybenzoic acid;pyridine-3-carboxamide |
| SMILES | NC(=O)c1cccnc1.O=C(O)c1ccc(O)cc1 |
| InChI | InChI=1S/C7H6O3.C6H6N2O/c8-6-3-1-5(2-4-6)7(9)10;7-6(9)5-2-1-3-8-4-5/h1-4,8H,(H,9,10);1-4H,(H2,7,9) |
| InChIKey | ZTOJOQVYMATCDU-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 113.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.25 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-hydroxybenzoic acid;pyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxybenzoic acid;pyridine-3-carboxamide?
The IUPAC name of 4-hydroxybenzoic acid;pyridine-3-carboxamide (CID 91936866) is 4-hydroxybenzoic acid;pyridine-3-carboxamide.
What is the SMILES notation for 4-hydroxybenzoic acid;pyridine-3-carboxamide?
The canonical SMILES for 4-hydroxybenzoic acid;pyridine-3-carboxamide is NC(=O)c1cccnc1.O=C(O)c1ccc(O)cc1.
What is the InChIKey of 4-hydroxybenzoic acid;pyridine-3-carboxamide?
The InChIKey is ZTOJOQVYMATCDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6O3.C6H6N2O/c8-6-3-1-5(2-4-6)7(9)10;7-6(9)5-2-1-3-8-4-5/h1-4,8H,(H,9,10);1-4H,(H2,7,9).
What are the key properties of 4-hydroxybenzoic acid;pyridine-3-carboxamide?
4-hydroxybenzoic acid;pyridine-3-carboxamide has a molecular weight of 260.25 g/mol, XLogP of 1.27, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxybenzoic acid;pyridine-3-carboxamide is sourced from PubChem (CID 91936866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).