About 10-hydroxy-2,2-dimethyl-6H-chromeno[7,6-b][1]benzoxepin-7-one
10-hydroxy-2,2-dimethyl-6H-chromeno[7,6-b][1]benzoxepin-7-one (PubChem CID 91937171) has the molecular formula C19H16O4
and a molecular weight of 308.33 g/mol. Its IUPAC name is 10-hydroxy-2,2-dimethyl-6H-chromeno[7,6-b][1]benzoxepin-7-one.
Molecular Properties
| Compound Name | 10-hydroxy-2,2-dimethyl-6H-chromeno[7,6-b][1]benzoxepin-7-one |
| PubChem CID | 91937171 |
| Molecular Formula | C19H16O4 |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | 10-hydroxy-2,2-dimethyl-6H-chromeno[7,6-b][1]benzoxepin-7-one |
| SMILES | CC1(C)C=Cc2cc3c(cc2O1)Oc1cc(O)ccc1C(=O)C3 |
| InChI | InChI=1S/C19H16O4/c1-19(2)6-5-11-7-12-8-15(21)14-4-3-13(20)9-18(14)22-16(12)10-17(11)23-19/h3-7,9-10,20H,8H2,1-2H3 |
| InChIKey | DKCYTDRJWSWOQP-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 10-hydroxy-2,2-dimethyl-6H-chromeno[7,6-b][1]benzoxepin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-hydroxy-2,2-dimethyl-6H-chromeno[7,6-b][1]benzoxepin-7-one?
The IUPAC name of 10-hydroxy-2,2-dimethyl-6H-chromeno[7,6-b][1]benzoxepin-7-one (CID 91937171) is 10-hydroxy-2,2-dimethyl-6H-chromeno[7,6-b][1]benzoxepin-7-one.
What is the SMILES notation for 10-hydroxy-2,2-dimethyl-6H-chromeno[7,6-b][1]benzoxepin-7-one?
The canonical SMILES for 10-hydroxy-2,2-dimethyl-6H-chromeno[7,6-b][1]benzoxepin-7-one is CC1(C)C=Cc2cc3c(cc2O1)Oc1cc(O)ccc1C(=O)C3.
What is the InChIKey of 10-hydroxy-2,2-dimethyl-6H-chromeno[7,6-b][1]benzoxepin-7-one?
The InChIKey is DKCYTDRJWSWOQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16O4/c1-19(2)6-5-11-7-12-8-15(21)14-4-3-13(20)9-18(14)22-16(12)10-17(11)23-19/h3-7,9-10,20H,8H2,1-2H3.
What are the key properties of 10-hydroxy-2,2-dimethyl-6H-chromeno[7,6-b][1]benzoxepin-7-one?
10-hydroxy-2,2-dimethyl-6H-chromeno[7,6-b][1]benzoxepin-7-one has a molecular weight of 308.33 g/mol, XLogP of 4.11, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 10-hydroxy-2,2-dimethyl-6H-chromeno[7,6-b][1]benzoxepin-7-one is sourced from PubChem (CID 91937171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).