C21H27NNaO7P — CID 91937256
sodium [[(2R,3S,5S)-4,5-dihydroxy-2-phenylmethoxy-6-(phenylmethoxymethyl)oxan-3-yl]amino]-methylphosphinate (PubChem CID 91937256) has the molecular formula C21H27NNaO7P and a molecular weight of 459.41 g/mol. Its IUPAC name is sodium [[(2R,3S,5S)-4,5-dihydroxy-2-phenylmethoxy-6-(phenylmethoxymethyl)oxan-3-yl]amino]-methylphosphinate.
| Compound Name | sodium [[(2R,3S,5S)-4,5-dihydroxy-2-phenylmethoxy-6-(phenylmethoxymethyl)oxan-3-yl]amino]-methylphosphinate |
|---|---|
| PubChem CID | 91937256 |
| Molecular Formula | C21H27NNaO7P |
| Molecular Weight | 459.41 g/mol |
| Exact Mass | 459.14 |
| IUPAC Name | sodium [[(2R,3S,5S)-4,5-dihydroxy-2-phenylmethoxy-6-(phenylmethoxymethyl)oxan-3-yl]amino]-methylphosphinate |
| SMILES | CP(=O)([O-])N[C@H]1C(O)[C@H](O)C(COCc2ccccc2)O[C@H]1OCc1ccccc1.[Na+] |
| InChI | InChI=1S/C21H28NO7P.Na/c1-30(25,26)22-18-20(24)19(23)17(14-27-12-15-8-4-2-5-9-15)29-21(18)28-13-16-10-6-3-7-11-16;/h2-11,17-21,23-24H,12-14H2,1H3,(H2,22,25,26);/q;+1/p-1/t17?,18-,19+,20?,21+;/m0./s1 |
| InChIKey | IBFWNDDTZHIDJG-DOSMRHMKSA-M |
| XLogP | -1.99 |
| TPSA | 120.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.41 |
| LogP ≤ 5 | -1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|