C24H27FN6O2 — CID 91937360
4-[[(3aS,4R,5R,6aS)-4-methyl-2-propanoyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]amino]-6-(6-fluoro-3-pyridinyl)pyrrolo[1,2-b]pyridazine-3-carboxamide (PubChem CID 91937360) has the molecular formula C24H27FN6O2 and a molecular weight of 450.52 g/mol. Its IUPAC name is 4-[[(3aS,4R,5R,6aS)-4-methyl-2-propanoyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]amino]-6-(6-fluoro-3-pyridinyl)pyrrolo[1,2-b]pyridazine-3-carboxamide.
| Compound Name | 4-[[(3aS,4R,5R,6aS)-4-methyl-2-propanoyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]amino]-6-(6-fluoro-3-pyridinyl)pyrrolo[1,2-b]pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 91937360 |
| Molecular Formula | C24H27FN6O2 |
| Molecular Weight | 450.52 g/mol |
| Exact Mass | 450.22 |
| IUPAC Name | 4-[[(3aS,4R,5R,6aS)-4-methyl-2-propanoyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]amino]-6-(6-fluoro-3-pyridinyl)pyrrolo[1,2-b]pyridazine-3-carboxamide |
| SMILES | CCC(=O)N1C[C@H]2C[C@@H](Nc3c(C(N)=O)cnn4cc(-c5ccc(F)nc5)cc34)[C@H](C)[C@H]2C1 |
| InChI | InChI=1S/C24H27FN6O2/c1-3-22(32)30-10-16-6-19(13(2)18(16)12-30)29-23-17(24(26)33)9-28-31-11-15(7-20(23)31)14-4-5-21(25)27-8-14/h4-5,7-9,11,13,16,18-19,29H,3,6,10,12H2,1-2H3,(H2,26,33)/t13-,16-,18-,19-/m1/s1 |
| InChIKey | GOGAPLINTFESOO-ZQNRLITLSA-N |
| XLogP | 2.94 |
| TPSA | 105.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.52 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|