C29H32F3N5O5 — CID 91937568
methyl N-[(1S,2R,4R,6S)-2-amino-4-[3-[[6-[2,6-difluoro-4-(2-methoxyethoxy)phenyl]-5-fluoropyridine-2-carbonyl]amino]-4-pyridinyl]-6-methylcyclohexyl]carbamate (PubChem CID 91937568) has the molecular formula C29H32F3N5O5 and a molecular weight of 587.60 g/mol. Its IUPAC name is methyl N-[(1S,2R,4R,6S)-2-amino-4-[3-[[6-[2,6-difluoro-4-(2-methoxyethoxy)phenyl]-5-fluoropyridine-2-carbonyl]amino]-4-pyridinyl]-6-methylcyclohexyl]carbamate.
| Compound Name | methyl N-[(1S,2R,4R,6S)-2-amino-4-[3-[[6-[2,6-difluoro-4-(2-methoxyethoxy)phenyl]-5-fluoropyridine-2-carbonyl]amino]-4-pyridinyl]-6-methylcyclohexyl]carbamate |
|---|---|
| PubChem CID | 91937568 |
| Molecular Formula | C29H32F3N5O5 |
| Molecular Weight | 587.60 g/mol |
| Exact Mass | 587.24 |
| IUPAC Name | methyl N-[(1S,2R,4R,6S)-2-amino-4-[3-[[6-[2,6-difluoro-4-(2-methoxyethoxy)phenyl]-5-fluoropyridine-2-carbonyl]amino]-4-pyridinyl]-6-methylcyclohexyl]carbamate |
| SMILES | COCCOc1cc(F)c(-c2nc(C(=O)Nc3cnccc3[C@H]3C[C@@H](N)[C@@H](NC(=O)OC)[C@@H](C)C3)ccc2F)c(F)c1 |
| InChI | InChI=1S/C29H32F3N5O5/c1-15-10-16(11-22(33)26(15)37-29(39)41-3)18-6-7-34-14-24(18)36-28(38)23-5-4-19(30)27(35-23)25-20(31)12-17(13-21(25)32)42-9-8-40-2/h4-7,12-16,22,26H,8-11,33H2,1-3H3,(H,36,38)(H,37,39)/t15-,16+,22+,26-/m0/s1 |
| InChIKey | QUOGNIKIMQZJJU-ABBVGRBHSA-N |
| XLogP | 4.40 |
| TPSA | 137.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.60 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|