C30H33F3N4O5S — CID 91937569
N-[4-[(1R,3R,4S,5S)-3-amino-5-methyl-4-methylsulfonylcyclohexyl]-3-pyridinyl]-6-[2,6-difluoro-4-(oxan-4-yloxy)phenyl]-5-fluoropyridine-2-carboxamide (PubChem CID 91937569) has the molecular formula C30H33F3N4O5S and a molecular weight of 618.68 g/mol. Its IUPAC name is N-[4-[(1R,3R,4S,5S)-3-amino-5-methyl-4-methylsulfonylcyclohexyl]-3-pyridinyl]-6-[2,6-difluoro-4-(oxan-4-yloxy)phenyl]-5-fluoropyridine-2-carboxamide.
| Compound Name | N-[4-[(1R,3R,4S,5S)-3-amino-5-methyl-4-methylsulfonylcyclohexyl]-3-pyridinyl]-6-[2,6-difluoro-4-(oxan-4-yloxy)phenyl]-5-fluoropyridine-2-carboxamide |
|---|---|
| PubChem CID | 91937569 |
| Molecular Formula | C30H33F3N4O5S |
| Molecular Weight | 618.68 g/mol |
| Exact Mass | 618.21 |
| IUPAC Name | N-[4-[(1R,3R,4S,5S)-3-amino-5-methyl-4-methylsulfonylcyclohexyl]-3-pyridinyl]-6-[2,6-difluoro-4-(oxan-4-yloxy)phenyl]-5-fluoropyridine-2-carboxamide |
| SMILES | C[C@H]1C[C@@H](c2ccncc2NC(=O)c2ccc(F)c(-c3c(F)cc(OC4CCOCC4)cc3F)n2)C[C@@H](N)[C@H]1S(C)(=O)=O |
| InChI | InChI=1S/C30H33F3N4O5S/c1-16-11-17(12-24(34)29(16)43(2,39)40)20-5-8-35-15-26(20)37-30(38)25-4-3-21(31)28(36-25)27-22(32)13-19(14-23(27)33)42-18-6-9-41-10-7-18/h3-5,8,13-18,24,29H,6-7,9-12,34H2,1-2H3,(H,37,38)/t16-,17+,24+,29-/m0/s1 |
| InChIKey | KJJNLSMGLGFZKA-JVJYCYOPSA-N |
| XLogP | 4.62 |
| TPSA | 133.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.68 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |