C30H33F3N4O4 — CID 91937593
N-[4-[(1R,3R,4R,5S)-3-amino-4-methoxy-5-methylcyclohexyl]-3-pyridinyl]-6-[2,6-difluoro-4-(oxan-4-yloxy)phenyl]-5-fluoropyridine-2-carboxamide (PubChem CID 91937593) has the molecular formula C30H33F3N4O4 and a molecular weight of 570.61 g/mol. Its IUPAC name is N-[4-[(1R,3R,4R,5S)-3-amino-4-methoxy-5-methylcyclohexyl]-3-pyridinyl]-6-[2,6-difluoro-4-(oxan-4-yloxy)phenyl]-5-fluoropyridine-2-carboxamide.
| Compound Name | N-[4-[(1R,3R,4R,5S)-3-amino-4-methoxy-5-methylcyclohexyl]-3-pyridinyl]-6-[2,6-difluoro-4-(oxan-4-yloxy)phenyl]-5-fluoropyridine-2-carboxamide |
|---|---|
| PubChem CID | 91937593 |
| Molecular Formula | C30H33F3N4O4 |
| Molecular Weight | 570.61 g/mol |
| Exact Mass | 570.25 |
| IUPAC Name | N-[4-[(1R,3R,4R,5S)-3-amino-4-methoxy-5-methylcyclohexyl]-3-pyridinyl]-6-[2,6-difluoro-4-(oxan-4-yloxy)phenyl]-5-fluoropyridine-2-carboxamide |
| SMILES | CO[C@H]1[C@H](N)C[C@H](c2ccncc2NC(=O)c2ccc(F)c(-c3c(F)cc(OC4CCOCC4)cc3F)n2)C[C@@H]1C |
| InChI | InChI=1S/C30H33F3N4O4/c1-16-11-17(12-24(34)29(16)39-2)20-5-8-35-15-26(20)37-30(38)25-4-3-21(31)28(36-25)27-22(32)13-19(14-23(27)33)41-18-6-9-40-10-7-18/h3-5,8,13-18,24,29H,6-7,9-12,34H2,1-2H3,(H,37,38)/t16-,17+,24+,29+/m0/s1 |
| InChIKey | ITPBXRZSRGMCKW-PECJVUEUSA-N |
| XLogP | 5.23 |
| TPSA | 108.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.61 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |