C29H32F3N5O4 — CID 91937605
methyl N-[(1S,2R,4R,6S)-2-amino-4-[3-[[6-(2,6-difluoro-4-propan-2-yloxyphenyl)-5-fluoropyridine-2-carbonyl]amino]-4-pyridinyl]-6-methylcyclohexyl]carbamate (PubChem CID 91937605) has the molecular formula C29H32F3N5O4 and a molecular weight of 571.60 g/mol. Its IUPAC name is methyl N-[(1S,2R,4R,6S)-2-amino-4-[3-[[6-(2,6-difluoro-4-propan-2-yloxyphenyl)-5-fluoropyridine-2-carbonyl]amino]-4-pyridinyl]-6-methylcyclohexyl]carbamate.
| Compound Name | methyl N-[(1S,2R,4R,6S)-2-amino-4-[3-[[6-(2,6-difluoro-4-propan-2-yloxyphenyl)-5-fluoropyridine-2-carbonyl]amino]-4-pyridinyl]-6-methylcyclohexyl]carbamate |
|---|---|
| PubChem CID | 91937605 |
| Molecular Formula | C29H32F3N5O4 |
| Molecular Weight | 571.60 g/mol |
| Exact Mass | 571.24 |
| IUPAC Name | methyl N-[(1S,2R,4R,6S)-2-amino-4-[3-[[6-(2,6-difluoro-4-propan-2-yloxyphenyl)-5-fluoropyridine-2-carbonyl]amino]-4-pyridinyl]-6-methylcyclohexyl]carbamate |
| SMILES | COC(=O)N[C@@H]1[C@H](N)C[C@H](c2ccncc2NC(=O)c2ccc(F)c(-c3c(F)cc(OC(C)C)cc3F)n2)C[C@@H]1C |
| InChI | InChI=1S/C29H32F3N5O4/c1-14(2)41-17-11-20(31)25(21(32)12-17)27-19(30)5-6-23(35-27)28(38)36-24-13-34-8-7-18(24)16-9-15(3)26(22(33)10-16)37-29(39)40-4/h5-8,11-16,22,26H,9-10,33H2,1-4H3,(H,36,38)(H,37,39)/t15-,16+,22+,26-/m0/s1 |
| InChIKey | VNFMQMVCRRHLOL-ABBVGRBHSA-N |
| XLogP | 5.17 |
| TPSA | 128.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.60 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |