C30H32F3N5O4 — CID 91937620
methyl N-[(1S,2R,4R,6S)-2-amino-4-[3-[[6-[2,6-difluoro-4-(1-hydroxycyclobutyl)phenyl]-5-fluoropyridine-2-carbonyl]amino]-4-pyridinyl]-6-methylcyclohexyl]carbamate (PubChem CID 91937620) has the molecular formula C30H32F3N5O4 and a molecular weight of 583.61 g/mol. Its IUPAC name is methyl N-[(1S,2R,4R,6S)-2-amino-4-[3-[[6-[2,6-difluoro-4-(1-hydroxycyclobutyl)phenyl]-5-fluoropyridine-2-carbonyl]amino]-4-pyridinyl]-6-methylcyclohexyl]carbamate.
| Compound Name | methyl N-[(1S,2R,4R,6S)-2-amino-4-[3-[[6-[2,6-difluoro-4-(1-hydroxycyclobutyl)phenyl]-5-fluoropyridine-2-carbonyl]amino]-4-pyridinyl]-6-methylcyclohexyl]carbamate |
|---|---|
| PubChem CID | 91937620 |
| Molecular Formula | C30H32F3N5O4 |
| Molecular Weight | 583.61 g/mol |
| Exact Mass | 583.24 |
| IUPAC Name | methyl N-[(1S,2R,4R,6S)-2-amino-4-[3-[[6-[2,6-difluoro-4-(1-hydroxycyclobutyl)phenyl]-5-fluoropyridine-2-carbonyl]amino]-4-pyridinyl]-6-methylcyclohexyl]carbamate |
| SMILES | COC(=O)N[C@@H]1[C@H](N)C[C@H](c2ccncc2NC(=O)c2ccc(F)c(-c3c(F)cc(C4(O)CCC4)cc3F)n2)C[C@@H]1C |
| InChI | InChI=1S/C30H32F3N5O4/c1-15-10-16(11-22(34)26(15)38-29(40)42-2)18-6-9-35-14-24(18)37-28(39)23-5-4-19(31)27(36-23)25-20(32)12-17(13-21(25)33)30(41)7-3-8-30/h4-6,9,12-16,22,26,41H,3,7-8,10-11,34H2,1-2H3,(H,37,39)(H,38,40)/t15-,16+,22+,26-/m0/s1 |
| InChIKey | HVZQLRXKWHBUAJ-ABBVGRBHSA-N |
| XLogP | 4.75 |
| TPSA | 139.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.61 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |