C31H32F3N7O3 — CID 91937623
N-[4-[(1R,3R,4S,5S)-3-amino-5-methyl-4-(triazol-1-yl)cyclohexyl]-3-pyridinyl]-6-[2,6-difluoro-4-(oxan-4-yloxy)phenyl]-5-fluoropyridine-2-carboxamide (PubChem CID 91937623) has the molecular formula C31H32F3N7O3 and a molecular weight of 607.64 g/mol. Its IUPAC name is N-[4-[(1R,3R,4S,5S)-3-amino-5-methyl-4-(triazol-1-yl)cyclohexyl]-3-pyridinyl]-6-[2,6-difluoro-4-(oxan-4-yloxy)phenyl]-5-fluoropyridine-2-carboxamide.
| Compound Name | N-[4-[(1R,3R,4S,5S)-3-amino-5-methyl-4-(triazol-1-yl)cyclohexyl]-3-pyridinyl]-6-[2,6-difluoro-4-(oxan-4-yloxy)phenyl]-5-fluoropyridine-2-carboxamide |
|---|---|
| PubChem CID | 91937623 |
| Molecular Formula | C31H32F3N7O3 |
| Molecular Weight | 607.64 g/mol |
| Exact Mass | 607.25 |
| IUPAC Name | N-[4-[(1R,3R,4S,5S)-3-amino-5-methyl-4-(triazol-1-yl)cyclohexyl]-3-pyridinyl]-6-[2,6-difluoro-4-(oxan-4-yloxy)phenyl]-5-fluoropyridine-2-carboxamide |
| SMILES | C[C@H]1C[C@@H](c2ccncc2NC(=O)c2ccc(F)c(-c3c(F)cc(OC4CCOCC4)cc3F)n2)C[C@@H](N)[C@H]1n1ccnn1 |
| InChI | InChI=1S/C31H32F3N7O3/c1-17-12-18(13-25(35)30(17)41-9-8-37-40-41)21-4-7-36-16-27(21)39-31(42)26-3-2-22(32)29(38-26)28-23(33)14-20(15-24(28)34)44-19-5-10-43-11-6-19/h2-4,7-9,14-19,25,30H,5-6,10-13,35H2,1H3,(H,39,42)/t17-,18+,25+,30-/m0/s1 |
| InChIKey | BLHWEGXFMWEIHN-ZYQIVFPSSA-N |
| XLogP | 5.04 |
| TPSA | 130.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.64 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |