C29H28F3N7O — CID 91937638
N-[4-[(1R,3R,4S,5S)-3-amino-5-methyl-4-(4-prop-1-en-2-yltriazol-1-yl)cyclohexyl]-3-pyridinyl]-6-(2,6-difluorophenyl)-5-fluoropyridine-2-carboxamide (PubChem CID 91937638) has the molecular formula C29H28F3N7O and a molecular weight of 547.59 g/mol. Its IUPAC name is N-[4-[(1R,3R,4S,5S)-3-amino-5-methyl-4-(4-prop-1-en-2-yltriazol-1-yl)cyclohexyl]-3-pyridinyl]-6-(2,6-difluorophenyl)-5-fluoropyridine-2-carboxamide.
| Compound Name | N-[4-[(1R,3R,4S,5S)-3-amino-5-methyl-4-(4-prop-1-en-2-yltriazol-1-yl)cyclohexyl]-3-pyridinyl]-6-(2,6-difluorophenyl)-5-fluoropyridine-2-carboxamide |
|---|---|
| PubChem CID | 91937638 |
| Molecular Formula | C29H28F3N7O |
| Molecular Weight | 547.59 g/mol |
| Exact Mass | 547.23 |
| IUPAC Name | N-[4-[(1R,3R,4S,5S)-3-amino-5-methyl-4-(4-prop-1-en-2-yltriazol-1-yl)cyclohexyl]-3-pyridinyl]-6-(2,6-difluorophenyl)-5-fluoropyridine-2-carboxamide |
| SMILES | C=C(C)c1cn([C@@H]2[C@H](N)C[C@H](c3ccncc3NC(=O)c3ccc(F)c(-c4c(F)cccc4F)n3)C[C@@H]2C)nn1 |
| InChI | InChI=1S/C29H28F3N7O/c1-15(2)25-14-39(38-37-25)28-16(3)11-17(12-22(28)33)18-9-10-34-13-24(18)36-29(40)23-8-7-21(32)27(35-23)26-19(30)5-4-6-20(26)31/h4-10,13-14,16-17,22,28H,1,11-12,33H2,2-3H3,(H,36,40)/t16-,17+,22+,28-/m0/s1 |
| InChIKey | RGZGZMHXTYKFAM-VEAWDGRHSA-N |
| XLogP | 5.52 |
| TPSA | 111.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.59 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |