About 1-(4-fluorophenyl)-3-[4-(6-nitro-2-oxochromen-3-yl)-1,3-thiazol-2-yl]urea
1-(4-fluorophenyl)-3-[4-(6-nitro-2-oxochromen-3-yl)-1,3-thiazol-2-yl]urea (PubChem CID 91937704) has the molecular formula C19H11FN4O5S
and a molecular weight of 426.39 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-3-[4-(6-nitro-2-oxochromen-3-yl)-1,3-thiazol-2-yl]urea.
Molecular Properties
| Compound Name | 1-(4-fluorophenyl)-3-[4-(6-nitro-2-oxochromen-3-yl)-1,3-thiazol-2-yl]urea |
| PubChem CID | 91937704 |
| Molecular Formula | C19H11FN4O5S |
| Molecular Weight | 426.39 g/mol |
| Exact Mass | 426.04 |
| IUPAC Name | 1-(4-fluorophenyl)-3-[4-(6-nitro-2-oxochromen-3-yl)-1,3-thiazol-2-yl]urea |
| SMILES | O=C(Nc1ccc(F)cc1)Nc1nc(-c2cc3cc([N+](=O)[O-])ccc3oc2=O)cs1 |
| InChI | InChI=1S/C19H11FN4O5S/c20-11-1-3-12(4-2-11)21-18(26)23-19-22-15(9-30-19)14-8-10-7-13(24(27)28)5-6-16(10)29-17(14)25/h1-9H,(H2,21,22,23,26) |
| InChIKey | KFBRZPHJODPHCN-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 127.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 426.39 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-fluorophenyl)-3-[4-(6-nitro-2-oxochromen-3-yl)-1,3-thiazol-2-yl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-fluorophenyl)-3-[4-(6-nitro-2-oxochromen-3-yl)-1,3-thiazol-2-yl]urea?
The IUPAC name of 1-(4-fluorophenyl)-3-[4-(6-nitro-2-oxochromen-3-yl)-1,3-thiazol-2-yl]urea (CID 91937704) is 1-(4-fluorophenyl)-3-[4-(6-nitro-2-oxochromen-3-yl)-1,3-thiazol-2-yl]urea.
What is the SMILES notation for 1-(4-fluorophenyl)-3-[4-(6-nitro-2-oxochromen-3-yl)-1,3-thiazol-2-yl]urea?
The canonical SMILES for 1-(4-fluorophenyl)-3-[4-(6-nitro-2-oxochromen-3-yl)-1,3-thiazol-2-yl]urea is O=C(Nc1ccc(F)cc1)Nc1nc(-c2cc3cc([N+](=O)[O-])ccc3oc2=O)cs1.
What is the InChIKey of 1-(4-fluorophenyl)-3-[4-(6-nitro-2-oxochromen-3-yl)-1,3-thiazol-2-yl]urea?
The InChIKey is KFBRZPHJODPHCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H11FN4O5S/c20-11-1-3-12(4-2-11)21-18(26)23-19-22-15(9-30-19)14-8-10-7-13(24(27)28)5-6-16(10)29-17(14)25/h1-9H,(H2,21,22,23,26).
What are the key properties of 1-(4-fluorophenyl)-3-[4-(6-nitro-2-oxochromen-3-yl)-1,3-thiazol-2-yl]urea?
1-(4-fluorophenyl)-3-[4-(6-nitro-2-oxochromen-3-yl)-1,3-thiazol-2-yl]urea has a molecular weight of 426.39 g/mol, XLogP of 4.61, 4 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-fluorophenyl)-3-[4-(6-nitro-2-oxochromen-3-yl)-1,3-thiazol-2-yl]urea is sourced from PubChem (CID 91937704), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).