C48H52N6O6S2 — CID 91937719
benzyl N-[1-oxo-7-[[(6S)-7-oxo-6-(phenylmethoxycarbonylamino)-7-(quinolin-8-ylamino)heptyl]disulfanyl]-1-(quinolin-8-ylamino)heptan-2-yl]carbamate (PubChem CID 91937719) has the molecular formula C48H52N6O6S2 and a molecular weight of 873.11 g/mol. Its IUPAC name is benzyl N-[1-oxo-7-[[(6S)-7-oxo-6-(phenylmethoxycarbonylamino)-7-(quinolin-8-ylamino)heptyl]disulfanyl]-1-(quinolin-8-ylamino)heptan-2-yl]carbamate.
| Compound Name | benzyl N-[1-oxo-7-[[(6S)-7-oxo-6-(phenylmethoxycarbonylamino)-7-(quinolin-8-ylamino)heptyl]disulfanyl]-1-(quinolin-8-ylamino)heptan-2-yl]carbamate |
|---|---|
| PubChem CID | 91937719 |
| Molecular Formula | C48H52N6O6S2 |
| Molecular Weight | 873.11 g/mol |
| Exact Mass | 872.34 |
| IUPAC Name | benzyl N-[1-oxo-7-[[(6S)-7-oxo-6-(phenylmethoxycarbonylamino)-7-(quinolin-8-ylamino)heptyl]disulfanyl]-1-(quinolin-8-ylamino)heptan-2-yl]carbamate |
| SMILES | O=C(NC(CCCCCSSCCCCC[C@H](NC(=O)OCc1ccccc1)C(=O)Nc1cccc2cccnc12)C(=O)Nc1cccc2cccnc12)OCc1ccccc1 |
| InChI | InChI=1S/C48H52N6O6S2/c55-45(51-39-27-13-21-37-23-15-29-49-43(37)39)41(53-47(57)59-33-35-17-5-1-6-18-35)25-9-3-11-31-61-62-32-12-4-10-26-42(54-48(58)60-34-36-19-7-2-8-20-36)46(56)52-40-28-14-22-38-24-16-30-50-44(38)40/h1-2,5-8,13-24,27-30,41-42H,3-4,9-12,25-26,31-34H2,(H,51,55)(H,52,56)(H,53,57)(H,54,58)/t41-,42?/m0/s1 |
| InChIKey | XQPDEMOFEZWKBH-DYJLHVNUSA-N |
| XLogP | 10.45 |
| TPSA | 160.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 873.11 |
| LogP ≤ 5 | 10.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|