C21H25N3O6S — CID 91937769
7,8-dimethoxy-5-[[(1-methylsulfonylpiperidin-4-yl)amino]methyl]benzo[e]isoindole-1,3-dione (PubChem CID 91937769) has the molecular formula C21H25N3O6S and a molecular weight of 447.51 g/mol. Its IUPAC name is 7,8-dimethoxy-5-[[(1-methylsulfonylpiperidin-4-yl)amino]methyl]benzo[e]isoindole-1,3-dione.
| Compound Name | 7,8-dimethoxy-5-[[(1-methylsulfonylpiperidin-4-yl)amino]methyl]benzo[e]isoindole-1,3-dione |
|---|---|
| PubChem CID | 91937769 |
| Molecular Formula | C21H25N3O6S |
| Molecular Weight | 447.51 g/mol |
| Exact Mass | 447.15 |
| IUPAC Name | 7,8-dimethoxy-5-[[(1-methylsulfonylpiperidin-4-yl)amino]methyl]benzo[e]isoindole-1,3-dione |
| SMILES | COc1cc2c(CNC3CCN(S(C)(=O)=O)CC3)cc3c(c2cc1OC)C(=O)NC3=O |
| InChI | InChI=1S/C21H25N3O6S/c1-29-17-9-14-12(11-22-13-4-6-24(7-5-13)31(3,27)28)8-16-19(21(26)23-20(16)25)15(14)10-18(17)30-2/h8-10,13,22H,4-7,11H2,1-3H3,(H,23,25,26) |
| InChIKey | JCHZFJWNFQGPTA-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.51 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|