C30H21Br2ClN4S — CID 91937826
1-[4-[bis(5-bromo-1H-indol-3-yl)methyl]phenyl]-3-(3-chlorophenyl)thiourea (PubChem CID 91937826) has the molecular formula C30H21Br2ClN4S and a molecular weight of 664.85 g/mol. Its IUPAC name is 1-[4-[bis(5-bromo-1H-indol-3-yl)methyl]phenyl]-3-(3-chlorophenyl)thiourea.
| Compound Name | 1-[4-[bis(5-bromo-1H-indol-3-yl)methyl]phenyl]-3-(3-chlorophenyl)thiourea |
|---|---|
| PubChem CID | 91937826 |
| Molecular Formula | C30H21Br2ClN4S |
| Molecular Weight | 664.85 g/mol |
| Exact Mass | 661.95 |
| IUPAC Name | 1-[4-[bis(5-bromo-1H-indol-3-yl)methyl]phenyl]-3-(3-chlorophenyl)thiourea |
| SMILES | S=C(Nc1ccc(C(c2c[nH]c3ccc(Br)cc23)c2c[nH]c3ccc(Br)cc23)cc1)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C30H21Br2ClN4S/c31-18-6-10-27-23(12-18)25(15-34-27)29(26-16-35-28-11-7-19(32)13-24(26)28)17-4-8-21(9-5-17)36-30(38)37-22-3-1-2-20(33)14-22/h1-16,29,34-35H,(H2,36,37,38) |
| InChIKey | DPKYTTSGMSIJHN-UHFFFAOYSA-N |
| XLogP | 9.82 |
| TPSA | 55.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.85 |
| LogP ≤ 5 | 9.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|