C16H16F3N3O2S2 — CID 91938063
5-cyclopropyl-2-(1,3-thiazol-2-yl)-N-(6,6,6-trifluoro-5-oxohexyl)-1,3-thiazole-4-carboxamide (PubChem CID 91938063) has the molecular formula C16H16F3N3O2S2 and a molecular weight of 403.45 g/mol. Its IUPAC name is 5-cyclopropyl-2-(1,3-thiazol-2-yl)-N-(6,6,6-trifluoro-5-oxohexyl)-1,3-thiazole-4-carboxamide.
| Compound Name | 5-cyclopropyl-2-(1,3-thiazol-2-yl)-N-(6,6,6-trifluoro-5-oxohexyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 91938063 |
| Molecular Formula | C16H16F3N3O2S2 |
| Molecular Weight | 403.45 g/mol |
| Exact Mass | 403.06 |
| IUPAC Name | 5-cyclopropyl-2-(1,3-thiazol-2-yl)-N-(6,6,6-trifluoro-5-oxohexyl)-1,3-thiazole-4-carboxamide |
| SMILES | O=C(NCCCCC(=O)C(F)(F)F)c1nc(-c2nccs2)sc1C1CC1 |
| InChI | InChI=1S/C16H16F3N3O2S2/c17-16(18,19)10(23)3-1-2-6-20-13(24)11-12(9-4-5-9)26-15(22-11)14-21-7-8-25-14/h7-9H,1-6H2,(H,20,24) |
| InChIKey | OHRUWOKDVPCLPC-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.45 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|