About 4,6-di(piperidin-1-yl)-2-pyridin-2-ylquinoline;hydrobromide
4,6-di(piperidin-1-yl)-2-pyridin-2-ylquinoline;hydrobromide (PubChem CID 91938127) has the molecular formula C24H29BrN4
and a molecular weight of 453.43 g/mol. Its IUPAC name is 4,6-di(piperidin-1-yl)-2-pyridin-2-ylquinoline;hydrobromide.
Molecular Properties
| Compound Name | 4,6-di(piperidin-1-yl)-2-pyridin-2-ylquinoline;hydrobromide |
| PubChem CID | 91938127 |
| Molecular Formula | C24H29BrN4 |
| Molecular Weight | 453.43 g/mol |
| Exact Mass | 452.16 |
| IUPAC Name | 4,6-di(piperidin-1-yl)-2-pyridin-2-ylquinoline;hydrobromide |
| SMILES | Br.c1ccc(-c2cc(N3CCCCC3)c3cc(N4CCCCC4)ccc3n2)nc1 |
| InChI | InChI=1S/C24H28N4.BrH/c1-5-13-27(14-6-1)19-10-11-21-20(17-19)24(28-15-7-2-8-16-28)18-23(26-21)22-9-3-4-12-25-22;/h3-4,9-12,17-18H,1-2,5-8,13-16H2;1H |
| InChIKey | DKZYHOVZDINREN-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 453.43 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4,6-di(piperidin-1-yl)-2-pyridin-2-ylquinoline;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,6-di(piperidin-1-yl)-2-pyridin-2-ylquinoline;hydrobromide?
The IUPAC name of 4,6-di(piperidin-1-yl)-2-pyridin-2-ylquinoline;hydrobromide (CID 91938127) is 4,6-di(piperidin-1-yl)-2-pyridin-2-ylquinoline;hydrobromide.
What is the SMILES notation for 4,6-di(piperidin-1-yl)-2-pyridin-2-ylquinoline;hydrobromide?
The canonical SMILES for 4,6-di(piperidin-1-yl)-2-pyridin-2-ylquinoline;hydrobromide is Br.c1ccc(-c2cc(N3CCCCC3)c3cc(N4CCCCC4)ccc3n2)nc1.
What is the InChIKey of 4,6-di(piperidin-1-yl)-2-pyridin-2-ylquinoline;hydrobromide?
The InChIKey is DKZYHOVZDINREN-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H28N4.BrH/c1-5-13-27(14-6-1)19-10-11-21-20(17-19)24(28-15-7-2-8-16-28)18-23(26-21)22-9-3-4-12-25-22;/h3-4,9-12,17-18H,1-2,5-8,13-16H2;1H.
What are the key properties of 4,6-di(piperidin-1-yl)-2-pyridin-2-ylquinoline;hydrobromide?
4,6-di(piperidin-1-yl)-2-pyridin-2-ylquinoline;hydrobromide has a molecular weight of 453.43 g/mol, XLogP of 5.86, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6-di(piperidin-1-yl)-2-pyridin-2-ylquinoline;hydrobromide is sourced from PubChem (CID 91938127), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).